![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | 01 KAFEL Z WYSTAWY wystawy ARCHEOLOGICZNE ŚWIADECTWA KULTU MARYJNEGO W ŚREDNIOWIECZNYM GDAŃSKU (Archiwum fotografii MA Gdańsk).jpg | 2017-11-27 16:36 | 63K | |
![[IMG]](/icons/image2.gif) | 01-1.jpg | 2017-11-27 16:39 | 554K | |
![[IMG]](/icons/image2.gif) | Hatszepsut MMA 29.3.2.jpg | 2017-11-27 17:33 | 1.2M | |
![[IMG]](/icons/image2.gif) | 440521_0_69.jpg | 2017-11-27 17:37 | 29K | |
![[IMG]](/icons/image2.gif) | Obraz26.jpg | 2017-11-27 17:43 | 61K | |
![[IMG]](/icons/image2.gif) | 1.jpg | 2017-11-30 12:56 | 268K | |
![[IMG]](/icons/image2.gif) | 2.jpg | 2017-11-30 12:56 | 293K | |
![[IMG]](/icons/image2.gif) | 3.jpg | 2017-11-30 12:56 | 309K | |
![[IMG]](/icons/image2.gif) | 4.jpg | 2017-11-30 12:56 | 269K | |
![[IMG]](/icons/image2.gif) | 5.jpg | 2017-11-30 12:56 | 339K | |
![[IMG]](/icons/image2.gif) | 6.jpg | 2017-11-30 12:56 | 321K | |
![[IMG]](/icons/image2.gif) | 7.jpg | 2017-11-30 12:56 | 328K | |
![[IMG]](/icons/image2.gif) | 8.jpg | 2017-11-30 12:56 | 220K | |
![[IMG]](/icons/image2.gif) | 16 Łuk- ikona wpisu.jpg | 2017-12-06 12:50 | 202K | |
![[IMG]](/icons/image2.gif) | 17 Stara rycina palac- ikona wpisu.jpg | 2017-12-22 12:20 | 261K | |
![[IMG]](/icons/image2.gif) | 18 Do filmu o odbudowie muzeum- ikona wpisu.jpg | 2017-12-22 12:30 | 187K | |
![[IMG]](/icons/image2.gif) | 19 Wyjątki z Artykułu- ikona wpisu.jpg | 2017-12-22 15:44 | 217K | |
![[IMG]](/icons/image2.gif) | 0021 Widok klasztornej.jpg | 2017-12-22 18:40 | 251K | |
![[IMG]](/icons/image2.gif) | 0022 Widok klasztornej.jpg | 2017-12-22 20:17 | 419K | |
![[IMG]](/icons/image2.gif) | 0023 KAfel.jpg | 2017-12-22 20:25 | 145K | |
![[IMG]](/icons/image2.gif) | 0024 Lech Krzyżaniak.jpg | 2017-12-22 20:34 | 242K | |
![[IMG]](/icons/image2.gif) | 0025 Lech Krzyżaniak.jpg | 2017-12-22 20:41 | 67K | |
![[IMG]](/icons/image2.gif) | 0026 Solidarność.jpg | 2017-12-22 21:14 | 57K | |
![[IMG]](/icons/image2.gif) | 0027 Media.jpg | 2017-12-22 21:27 | 154K | |
![[IMG]](/icons/image2.gif) | 0028 Godziny otwarcia.jpg | 2017-12-22 21:37 | 105K | |
![[IMG]](/icons/image2.gif) | 0029 Bilety.jpg | 2017-12-22 21:42 | 163K | |
![[IMG]](/icons/image2.gif) | Obraz1.jpg | 2017-12-23 19:34 | 64K | |
![[IMG]](/icons/image2.gif) | Obraz2.jpg | 2017-12-23 19:38 | 131K | |
![[IMG]](/icons/image2.gif) | Obraz3.jpg | 2017-12-24 07:02 | 18K | |
![[IMG]](/icons/image2.gif) | Obraz3(1).jpg | 2017-12-24 07:02 | 18K | |
![[IMG]](/icons/image2.gif) | Obraz17.jpg | 2017-12-24 10:57 | 85K | |
![[IMG]](/icons/image2.gif) | Obraz12.jpg | 2017-12-24 10:57 | 58K | |
![[IMG]](/icons/image2.gif) | Obraz13.jpg | 2017-12-24 10:57 | 43K | |
![[IMG]](/icons/image2.gif) | Obraz14.jpg | 2017-12-24 10:57 | 77K | |
![[IMG]](/icons/image2.gif) | Obraz15.jpg | 2017-12-24 10:57 | 103K | |
![[IMG]](/icons/image2.gif) | Obraz16.jpg | 2017-12-24 10:57 | 28K | |
![[IMG]](/icons/image2.gif) | 0029 Bliskie z....jpg | 2017-12-24 14:55 | 113K | |
![[IMG]](/icons/image2.gif) | 0030 Czasówka parter....jpg | 2017-12-25 08:40 | 116K | |
![[IMG]](/icons/image2.gif) | 0031 Czasówka podziemie.jpg | 2017-12-25 10:21 | 189K | |
![[IMG]](/icons/image2.gif) | 0032 Dziedziniec.jpg | 2017-12-26 09:45 | 221K | |
![[IMG]](/icons/image2.gif) | 0033 Dziedziniec.jpg | 2017-12-27 15:23 | 267K | |
![[IMG]](/icons/image2.gif) | DSC03639.jpg | 2017-12-27 16:24 | 115K | |
![[IMG]](/icons/image2.gif) | DSC_0978.JPG | 2017-12-27 18:27 | 4.3M | |
![[IMG]](/icons/image2.gif) | 23-Zajęcia-plastyczne-dla-dzieci.jpg | 2017-12-27 19:04 | 799K | |
![[IMG]](/icons/image2.gif) | 52ecfb735e6f2_o.jpg | 2017-12-28 14:12 | 211K | |
![[IMG]](/icons/image2.gif) | lmuz1.jpg | 2017-12-28 14:16 | 107K | |
![[IMG]](/icons/image2.gif) | 20150624_092129.jpg | 2017-12-28 14:18 | 53K | |
![[IMG]](/icons/image2.gif) | 5FGCTE.jpg | 2017-12-29 21:38 | 913K | |
![[IMG]](/icons/image2.gif) | image29.jpg | 2017-12-29 21:45 | 1.8M | |
![[ ]](/icons/unknown.gif) | wniosek.doc | 2017-12-30 11:43 | 29K | |
![[IMG]](/icons/image2.gif) | Obraz1(1).jpg | 2017-12-30 11:47 | 126K | |
![[IMG]](/icons/image2.gif) | 15540664_1771470279783681_1050997542351876361_o.jpg | 2018-01-01 21:14 | 267K | |
![[IMG]](/icons/image2.gif) | s00006a.jpg | 2018-01-01 21:16 | 43K | |
![[IMG]](/icons/image2.gif) | 037.jpg | 2018-01-01 22:17 | 1.7M | |
![[IMG]](/icons/image2.gif) | 035.jpg | 2018-01-01 22:22 | 4.7M | |
![[IMG]](/icons/image2.gif) | Poznan-1618.jpg | 2018-01-02 10:53 | 572K | |
![[IMG]](/icons/image2.gif) | K_Ladies_Hill3_XI_00d.jpg | 2018-01-02 10:59 | 66K | |
![[IMG]](/icons/image2.gif) | DDiIN_1.jpg | 2018-01-02 13:11 | 49K | |
![[IMG]](/icons/image2.gif) | pracownia_konserwacji.jpg | 2018-01-02 13:15 | 29K | |
![[IMG]](/icons/image2.gif) | lmuz3.jpg | 2018-01-02 16:15 | 51K | |
![[IMG]](/icons/image2.gif) | książka3.jpg | 2018-01-02 16:22 | 31K | |
![[IMG]](/icons/image2.gif) | DSCN6657.JPG | 2018-01-03 15:39 | 739K | |
![[IMG]](/icons/image2.gif) | 0001 Muzarp.jpg | 2018-02-02 23:04 | 414K | |
![[IMG]](/icons/image2.gif) | Obraz1(2).jpg | 2018-02-12 22:10 | 55K | |
![[IMG]](/icons/image2.gif) | Obraz2(1).jpg | 2018-02-12 22:11 | 43K | |
![[IMG]](/icons/image2.gif) | Obraz3(2).jpg | 2018-02-12 22:12 | 77K | |
![[IMG]](/icons/image2.gif) | Obraz4.jpg | 2018-02-12 22:12 | 109K | |
![[IMG]](/icons/image2.gif) | Obraz5.jpg | 2018-02-12 22:14 | 31K | |
![[IMG]](/icons/image2.gif) | Obraz6.jpg | 2018-02-12 22:15 | 84K | |
![[ ]](/icons/layout.gif) | XXI-Konferencja-pismo-przewodnie-MAP_ŁP-1.pdf | 2018-02-26 13:47 | 334K | |
![[ ]](/icons/layout.gif) | XXI-Konferencja-zgłoszenie-referenta.pdf | 2018-02-26 13:48 | 440K | |
![[ ]](/icons/layout.gif) | XXI-Konferencja-zgloszenie-sluchacza-MAP-1-2.pdf | 2018-02-26 13:49 | 436K | |
![[IMG]](/icons/image2.gif) | 275x550.jpg | 2018-02-26 13:54 | 149K | |
![[IMG]](/icons/image2.gif) | 02 Rez.jpg | 2018-02-26 15:36 | 193K | |
![[IMG]](/icons/image2.gif) | pjn.jpg | 2018-02-27 22:26 | 745K | |
![[IMG]](/icons/image2.gif) | 05.jpg | 2018-02-27 22:32 | 746K | |
![[IMG]](/icons/image2.gif) | 04.jpg | 2018-02-27 22:32 | 742K | |
![[IMG]](/icons/image2.gif) | 02.jpg | 2018-02-27 22:32 | 667K | |
![[IMG]](/icons/image2.gif) | 03.jpg | 2018-02-27 22:32 | 429K | |
![[IMG]](/icons/image2.gif) | Plakat .jpg | 2018-02-27 22:42 | 21M | |
![[IMG]](/icons/image2.gif) | Skarb austro-węgierskich monet, koniec XIX w., ul. Krakowska (2).jpg | 2018-02-27 22:59 | 1.5M | |
![[IMG]](/icons/image2.gif) | Talerze Glazurowane XVII w., pl. Zwenygorodski (2).jpg | 2018-02-27 22:59 | 2.7M | |
![[IMG]](/icons/image2.gif) | 05 Artefakty ekspozycji - fot. Instytutu Archeologii Narodowej Akademii Nauk Ukrainy we Lwowie.jpg | 2018-02-27 22:59 | 80K | |
![[IMG]](/icons/image2.gif) | 06 Artefakty ekspozycji - Instytutu Archeologii Narodowej Akademii Nauk Ukrainy we Lwowie.jpg | 2018-02-27 22:59 | 59K | |
![[IMG]](/icons/image2.gif) | Biały Potok Infografika.jpg | 2018-02-28 15:05 | 1.0M | |
![[IMG]](/icons/image2.gif) | 20.07.2013 094.jpg | 2018-02-28 15:14 | 1.5M | |
![[IMG]](/icons/image2.gif) | 4.07.2013 171 (1).jpg | 2018-02-28 15:14 | 1.4M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu.jpg | 2018-02-28 16:04 | 102K | |
![[IMG]](/icons/image2.gif) | on0np.jpg | 2018-02-28 16:21 | 345K | |
![[IMG]](/icons/image2.gif) | lk pon;.jpg | 2018-02-28 16:34 | 461K | |
![[IMG]](/icons/image2.gif) | logo.png | 2018-02-28 16:44 | 5.0K | |
![[IMG]](/icons/image2.gif) | Obraz8.jpg | 2018-02-28 16:45 | 7.9K | |
![[IMG]](/icons/image2.gif) | 50wd.jpg | 2018-03-01 10:45 | 58K | |
![[IMG]](/icons/image2.gif) | 53wd.jpg | 2018-03-01 10:45 | 42K | |
![[IMG]](/icons/image2.gif) | 48wd.jpg | 2018-03-01 10:45 | 57K | |
![[IMG]](/icons/image2.gif) | 49wd.jpg | 2018-03-01 10:45 | 53K | |
![[IMG]](/icons/image2.gif) | ihvolb.jpg | 2018-03-01 10:47 | 190K | |
![[IMG]](/icons/image2.gif) | 04 Fragment Irlandzkiej ekspozycji fot. Archiwum MAP.jpg | 2018-03-04 19:25 | 62K | |
![[ ]](/icons/layout.gif) | Regulamin imprez urodzinowych.pdf | 2018-03-06 11:55 | 122K | |
![[ ]](/icons/layout.gif) | Program I Festiwalu - BUDUJEMY GRÓD I KLASZTOR W LĄDZIE.pdf | 2018-03-06 20:41 | 336K | |
![[ ]](/icons/layout.gif) | Cyfrowy_archeolog_PDF_v1.2.pdf | 2018-03-06 21:13 | 8.5M | |
![[ ]](/icons/unknown.gif) | Cyfrowy_archeolog_ePUB_v5.epub | 2018-03-06 21:15 | 9.5M | |
![[SND]](/icons/sound2.gif) | 01.mp3 | 2018-03-06 22:22 | 932K | |
![[SND]](/icons/sound2.gif) | 01(1).mp3 | 2018-03-06 22:26 | 932K | |
![[SND]](/icons/sound2.gif) | 02.mp3 | 2018-03-06 22:26 | 1.7M | |
![[SND]](/icons/sound2.gif) | 03.mp3 | 2018-03-06 22:26 | 858K | |
![[SND]](/icons/sound2.gif) | 04.mp3 | 2018-03-06 22:26 | 926K | |
![[SND]](/icons/sound2.gif) | 05.mp3 | 2018-03-06 22:27 | 642K | |
![[SND]](/icons/sound2.gif) | 06.mp3 | 2018-03-06 22:27 | 855K | |
![[SND]](/icons/sound2.gif) | 07.mp3 | 2018-03-06 22:27 | 592K | |
![[SND]](/icons/sound2.gif) | 08.mp3 | 2018-03-06 22:27 | 754K | |
![[SND]](/icons/sound2.gif) | 09.mp3 | 2018-03-06 22:28 | 889K | |
![[SND]](/icons/sound2.gif) | 10.mp3 | 2018-03-06 22:28 | 785K | |
![[SND]](/icons/sound2.gif) | 11.mp3 | 2018-03-06 22:28 | 487K | |
![[SND]](/icons/sound2.gif) | 12.mp3 | 2018-03-06 22:28 | 758K | |
![[SND]](/icons/sound2.gif) | 13.mp3 | 2018-03-06 22:28 | 344K | |
![[SND]](/icons/sound2.gif) | 14.mp3 | 2018-03-06 22:29 | 692K | |
![[SND]](/icons/sound2.gif) | 15.mp3 | 2018-03-06 22:29 | 378K | |
![[SND]](/icons/sound2.gif) | 16.mp3 | 2018-03-06 22:29 | 1.0M | |
![[SND]](/icons/sound2.gif) | 17.mp3 | 2018-03-06 22:30 | 900K | |
![[SND]](/icons/sound2.gif) | 01_WSTEP.mp3 | 2018-03-06 22:32 | 712K | |
![[SND]](/icons/sound2.gif) | 02_EGIPT_OBELISK.mp3 | 2018-03-06 22:32 | 1.8M | |
![[SND]](/icons/sound2.gif) | 03_SACHMET.mp3 | 2018-03-06 22:32 | 1.0M | |
![[SND]](/icons/sound2.gif) | 04_Smierc_PODGLOWEK.mp3 | 2018-03-06 22:33 | 1.0M | |
![[SND]](/icons/sound2.gif) | 05_KSIEGA_UMARLYCH.mp3 | 2018-03-06 22:33 | 769K | |
![[SND]](/icons/sound2.gif) | 06_MUMIE_ZWIERZAT.mp3 | 2018-03-06 22:33 | 1.2M | |
![[SND]](/icons/sound2.gif) | 07_SZTUKA_NASKALNA.mp3 | 2018-03-06 22:34 | 656K | |
![[SND]](/icons/sound2.gif) | 08_SUDAN.mp3 | 2018-03-06 22:34 | 797K | |
![[SND]](/icons/sound2.gif) | 09_PRADZIEJE_WIELKOPOLSKI.mp3 | 2018-03-06 22:34 | 792K | |
![[SND]](/icons/sound2.gif) | 10_WOLKI_z_BYTYNIA.mp3 | 2018-03-06 22:34 | 1.1M | |
![[SND]](/icons/sound2.gif) | 11_NAPIERSNIK_Z_MROWINA.mp3 | 2018-03-06 22:35 | 577K | |
![[SND]](/icons/sound2.gif) | 12_DZBAN _Z_KOWALEWKA.mp3 | 2018-03-06 22:35 | 883K | |
![[SND]](/icons/sound2.gif) | 13_TU_POWSTALA_POLSKA.mp3 | 2018-03-06 22:35 | 247K | |
![[SND]](/icons/sound2.gif) | 14_MIECZ.mp3 | 2018-03-06 22:35 | 963K | |
![[SND]](/icons/sound2.gif) | 15_HELM_Z_GIECZA.mp3 | 2018-03-06 22:36 | 869K | |
![[SND]](/icons/sound2.gif) | 16_TABLICZKI_WOSKOWE.mp3 | 2018-03-06 22:36 | 1.3M | |
![[SND]](/icons/sound2.gif) | 17_KAFEL.mp3 | 2018-03-06 22:36 | 1.0M | |
![[SND]](/icons/sound2.gif) | 01 (1).mp3 | 2018-03-06 22:39 | 931K | |
![[SND]](/icons/sound2.gif) | 02 (1).mp3 | 2018-03-06 22:39 | 1.8M | |
![[SND]](/icons/sound2.gif) | 03 (1).mp3 | 2018-03-06 22:39 | 897K | |
![[SND]](/icons/sound2.gif) | 04 (1).mp3 | 2018-03-06 22:40 | 960K | |
![[SND]](/icons/sound2.gif) | 05 (1).mp3 | 2018-03-06 22:40 | 633K | |
![[SND]](/icons/sound2.gif) | 06 (1).mp3 | 2018-03-06 22:40 | 898K | |
![[SND]](/icons/sound2.gif) | 07 (1).mp3 | 2018-03-06 22:40 | 690K | |
![[SND]](/icons/sound2.gif) | 08 (1).mp3 | 2018-03-06 22:41 | 816K | |
![[SND]](/icons/sound2.gif) | 09 (1).mp3 | 2018-03-06 22:41 | 1.0M | |
![[SND]](/icons/sound2.gif) | 10 (1).mp3 | 2018-03-06 22:41 | 871K | |
![[SND]](/icons/sound2.gif) | 11 (1).mp3 | 2018-03-06 22:42 | 734K | |
![[SND]](/icons/sound2.gif) | 12 (1).mp3 | 2018-03-06 22:42 | 773K | |
![[SND]](/icons/sound2.gif) | 13 (1).mp3 | 2018-03-06 22:42 | 364K | |
![[SND]](/icons/sound2.gif) | 14 (1).mp3 | 2018-03-06 22:43 | 793K | |
![[SND]](/icons/sound2.gif) | 15 (1).mp3 | 2018-03-06 22:43 | 404K | |
![[SND]](/icons/sound2.gif) | 16 (1).mp3 | 2018-03-06 22:43 | 1.3M | |
![[SND]](/icons/sound2.gif) | 17 (1).mp3 | 2018-03-06 22:43 | 1.0M | |
![[SND]](/icons/sound2.gif) | 01 (2).mp3 | 2018-03-06 22:45 | 695K | |
![[SND]](/icons/sound2.gif) | 02 (2).mp3 | 2018-03-06 22:45 | 1.8M | |
![[SND]](/icons/sound2.gif) | 03 (2).mp3 | 2018-03-06 22:46 | 1.1M | |
![[SND]](/icons/sound2.gif) | 04 (2).mp3 | 2018-03-06 22:46 | 1.0M | |
![[SND]](/icons/sound2.gif) | 05 (2).mp3 | 2018-03-06 22:46 | 719K | |
![[SND]](/icons/sound2.gif) | 06 (2).mp3 | 2018-03-06 22:46 | 1.2M | |
![[SND]](/icons/sound2.gif) | 07 (2).mp3 | 2018-03-06 22:46 | 547K | |
![[SND]](/icons/sound2.gif) | 08 (2).mp3 | 2018-03-06 22:47 | 758K | |
![[SND]](/icons/sound2.gif) | 09 (2).mp3 | 2018-03-06 22:47 | 796K | |
![[SND]](/icons/sound2.gif) | 10 (2).mp3 | 2018-03-06 22:47 | 1.1M | |
![[SND]](/icons/sound2.gif) | 11 (2).mp3 | 2018-03-06 22:47 | 563K | |
![[SND]](/icons/sound2.gif) | 12 (2).mp3 | 2018-03-06 22:48 | 826K | |
![[SND]](/icons/sound2.gif) | 13 (2).mp3 | 2018-03-06 22:48 | 246K | |
![[SND]](/icons/sound2.gif) | 14 (2).mp3 | 2018-03-06 22:48 | 939K | |
![[SND]](/icons/sound2.gif) | 15 (2).mp3 | 2018-03-06 22:48 | 639K | |
![[SND]](/icons/sound2.gif) | 16 (2).mp3 | 2018-03-06 22:49 | 1.2M | |
![[SND]](/icons/sound2.gif) | 17 (2).mp3 | 2018-03-06 22:49 | 1.0M | |
![[ ]](/icons/layout.gif) | Przeszłość w murach zachowana.pdf | 2018-03-06 22:51 | 1.1M | |
![[ ]](/icons/layout.gif) | The Past Enhanted Within The Walls - In English.pdf | 2018-03-06 22:51 | 918K | |
![[ ]](/icons/layout.gif) | REGULAMIN WARSZTATÓW DLA DZIECI ORGANIZOWANYCH PRZEZ MUZEUM ARCHEOLOGICZNE W POZNANIU.pdf | 2018-03-07 01:09 | 200K | |
![[IMG]](/icons/image2.gif) | Obraz8(1).jpg | 2018-03-07 01:12 | 176K | |
![[ ]](/icons/layout.gif) | MNISI i Rolnicy program.pdf | 2018-03-07 23:41 | 379K | |
![[ ]](/icons/layout.gif) | ArchTerra_final_report1.pdf | 2018-03-11 09:24 | 3.9M | |
![[IMG]](/icons/image2.gif) | lojbo.jpg | 2018-03-12 20:12 | 1.0M | |
![[IMG]](/icons/image2.gif) | obpn.jpg | 2018-03-12 20:26 | 224K | |
![[IMG]](/icons/image2.gif) | lbp;b;p.jpg | 2018-03-12 20:28 | 192K | |
![[IMG]](/icons/image2.gif) | ohivolb.jpg | 2018-03-12 20:30 | 84K | |
![[IMG]](/icons/image2.gif) | vblnpk.jpg | 2018-03-12 20:32 | 192K | |
![[IMG]](/icons/image2.gif) | Baner na stronę.jpg | 2018-03-13 18:56 | 300K | |
![[IMG]](/icons/image2.gif) | plakat_program_rrrr.jpg | 2018-03-14 15:15 | 96K | |
![[IMG]](/icons/image2.gif) | hsjeha.jpg | 2018-03-16 08:14 | 161K | |
![[IMG]](/icons/image2.gif) | 29133600_10214972534777554_6899693050663010304_n.jpg | 2018-03-16 12:52 | 21K | |
![[ ]](/icons/unknown.gif) | Formularz.doc | 2018-03-18 13:43 | 27K | |
![[IMG]](/icons/image2.gif) | Obraz3(3).jpg | 2018-03-18 21:35 | 207K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany].jpg | 2018-03-25 16:54 | 282K | |
![[ ]](/icons/layout.gif) | Konferencja sprawozdawcza 2018 - Program.pdf | 2018-03-25 19:27 | 243K | |
![[IMG]](/icons/image2.gif) | Wielkanoc.jpg | 2018-03-28 10:31 | 739K | |
![[IMG]](/icons/image2.gif) | 3(1).jpg | 2018-03-29 12:22 | 292K | |
![[IMG]](/icons/image2.gif) | WYk.jpg | 2018-04-16 21:23 | 74K | |
![[IMG]](/icons/image2.gif) | wykład 18 kwietnia 2018 r.jpg | 2018-04-16 21:29 | 473K | |
![[IMG]](/icons/image2.gif) | wykład 18 kwietnia 2018 r(1).jpg | 2018-04-16 21:29 | 473K | |
![[IMG]](/icons/image2.gif) | pn-pj.jpg | 2018-04-16 21:35 | 70K | |
![[IMG]](/icons/image2.gif) | sh.jpg | 2018-04-16 21:38 | 70K | |
![[IMG]](/icons/image2.gif) | 1ok-mały.jpg | 2018-04-17 11:56 | 289K | |
![[IMG]](/icons/image2.gif) | wykład 18 kwietnia 2018 r(2).jpg | 2018-04-17 12:05 | 473K | |
![[IMG]](/icons/image2.gif) | Obraz1(3).jpg | 2018-04-19 13:53 | 104K | |
![[IMG]](/icons/image2.gif) | Logotyp-poziomy-PFNiS.jpg | 2018-04-20 10:32 | 2.1M | |
![[IMG]](/icons/image2.gif) | D.jpg | 2018-04-20 10:33 | 66K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany](1).jpg | 2018-04-23 12:53 | 151K | |
![[IMG]](/icons/image2.gif) | 2321.jpg | 2018-04-26 11:26 | 22M | |
![[IMG]](/icons/image2.gif) | Cegiełka_fina1l.jpg | 2018-04-27 14:03 | 139K | |
![[IMG]](/icons/image2.gif) | HUman Doc.jpg | 2018-05-08 22:32 | 170K | |
![[IMG]](/icons/image2.gif) | Obraz1(4).jpg | 2018-05-14 14:01 | 16K | |
![[IMG]](/icons/image2.gif) | PDR2018.1.jpg | 2018-05-14 14:03 | 15K | |
![[IMG]](/icons/image2.gif) | Izabella 2017.jpg | 2018-05-23 13:06 | 158K | |
![[IMG]](/icons/image2.gif) | Plakat Archeo.png | 2018-06-07 10:11 | 1.2M | |
![[IMG]](/icons/image2.gif) | Swatka.jpg | 2018-06-07 10:12 | 47K | |
![[IMG]](/icons/image2.gif) | pkobpn.jpg | 2018-06-18 13:38 | 175K | |
![[IMG]](/icons/image2.gif) | lvljb.jpg | 2018-06-18 16:20 | 110K | |
![[IMG]](/icons/image2.gif) | plakat_Nieslabin.jpg | 2018-06-18 16:22 | 2.3M | |
![[IMG]](/icons/image2.gif) | plakat_Nieslabin(1).jpg | 2018-06-18 16:22 | 2.3M | |
![[IMG]](/icons/image2.gif) | phbbpn.jpg | 2018-06-21 11:07 | 83K | |
![[IMG]](/icons/image2.gif) | phbbpn(1).jpg | 2018-06-21 11:08 | 83K | |
![[IMG]](/icons/image2.gif) | ;lbk;n;.jpg | 2018-06-21 11:37 | 200K | |
![[IMG]](/icons/image2.gif) | Obraz1(5).jpg | 2018-06-27 11:57 | 72K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA.jpg | 2018-07-03 14:54 | 145K | |
![[ ]](/icons/layout.gif) | Poznań African Symposium 2019 first circular.pdf | 2018-07-04 11:52 | 194K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA [Automatycznie zapisany].jpg | 2018-08-14 13:18 | 202K | |
![[ ]](/icons/layout.gif) | Napachanie - całość na stronę MAP zmniejszony.pdf | 2018-08-27 13:35 | 17M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(1).jpg | 2018-08-30 12:25 | 235K | |
![[IMG]](/icons/image2.gif) | Obraz2(2).jpg | 2018-08-30 12:31 | 42K | |
![[IMG]](/icons/image2.gif) | Obraz4(1).jpg | 2018-08-30 12:32 | 40K | |
![[IMG]](/icons/image2.gif) | Obraz6(1).jpg | 2018-08-30 12:36 | 20K | |
![[IMG]](/icons/image2.gif) | LOGO_POZNAN_PL_RGB_bz.jpg | 2018-08-30 12:37 | 114K | |
![[IMG]](/icons/image2.gif) | 60mm.jpg | 2018-08-30 12:38 | 37K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA(1).jpg | 2018-09-07 09:04 | 55K | |
![[IMG]](/icons/image2.gif) | 10819.png | 2018-09-07 09:07 | 188K | |
![[IMG]](/icons/image2.gif) | EDDplakat2018finalA4.jpg | 2018-09-07 09:11 | 164K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA [Automatycznie zapisany](1).jpg | 2018-09-12 00:44 | 138K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA [Automatycznie zapisany](2).jpg | 2018-09-12 00:44 | 138K | |
![[IMG]](/icons/image2.gif) | 1070x410_V1.jpg | 2018-09-12 00:46 | 323K | |
![[IMG]](/icons/image2.gif) | 1070x410_V1(1).jpg | 2018-09-12 00:46 | 323K | |
![[IMG]](/icons/image2.gif) | 1070x410_BTC_V2.jpg | 2018-09-12 00:48 | 332K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA [Automatycznie zapisany](3).jpg | 2018-09-20 15:11 | 177K | |
![[IMG]](/icons/image2.gif) | plakat_Herby_internet.jpg | 2018-09-20 15:13 | 839K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA [Automatycznie zapisany](4).jpg | 2018-09-26 16:00 | 48K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA [Automatycznie zapisany](5).jpg | 2018-09-26 16:01 | 48K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA [Automatycznie zapisany](6).jpg | 2018-09-26 16:42 | 289K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisuKonf LPNEA [Automatycznie zapisany](7).jpg | 2018-09-26 21:13 | 70K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2).jpg | 2018-10-15 23:31 | 35K | |
![[IMG]](/icons/image2.gif) | 13494915_1623321181330295_65224046922536272_n.jpg | 2018-10-18 21:13 | 9.8K | |
![[IMG]](/icons/image2.gif) | II miejsce w konkursie Przyroda Warta Poznania Mateusz Piesiak Kszyki w ciszy.jpg | 2018-10-18 21:15 | 22K | |
![[IMG]](/icons/image2.gif) | II miejsce w konkursie Przyroda Warta Poznania Mateusz Piesiak Kszyki w ciszy(1).jpg | 2018-10-18 21:16 | 22K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(1).jpg | 2018-10-18 21:19 | 124K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(2).jpg | 2018-10-18 21:27 | 114K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(3).jpg | 2018-10-19 10:28 | 182K | |
![[IMG]](/icons/image2.gif) | Obraz1(6).jpg | 2018-10-19 10:30 | 219K | |
![[IMG]](/icons/image2.gif) | 1251.jpg | 2018-10-19 10:37 | 56K | |
![[IMG]](/icons/image2.gif) | 1250.jpg | 2018-10-19 10:38 | 62K | |
![[IMG]](/icons/image2.gif) | 1248.jpg | 2018-10-19 10:38 | 104K | |
![[IMG]](/icons/image2.gif) | 1249.jpg | 2018-10-19 10:39 | 72K | |
![[IMG]](/icons/image2.gif) | wykład 25 pażdziernika.jpg | 2018-10-19 11:38 | 854K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(4).jpg | 2018-10-19 11:40 | 168K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(5).jpg | 2018-10-22 13:50 | 237K | |
![[IMG]](/icons/image2.gif) | TVP3_Poznań.jpg | 2018-10-22 13:58 | 109K | |
![[IMG]](/icons/image2.gif) | Radio_Poznan_POZIOM_CMYK_wersja_na_biaąym_tle.png | 2018-10-22 13:59 | 126K | |
![[IMG]](/icons/image2.gif) | iks.jpg | 2018-10-22 14:05 | 773K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(6).jpg | 2018-10-24 13:25 | 142K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(7).jpg | 2018-10-31 06:29 | 86K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(8).jpg | 2018-10-31 11:52 | 137K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(9).jpg | 2018-10-31 11:54 | 145K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(10).jpg | 2018-10-31 11:58 | 141K | |
![[IMG]](/icons/image2.gif) | nekrologHK_MAP (2).jpg | 2018-10-31 12:00 | 581K | |
![[IMG]](/icons/image2.gif) | wykład 7 listopada 2018 r.jpg | 2018-11-05 09:54 | 708K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu [Automatycznie zapisany] (2)(11).jpg | 2018-11-05 09:57 | 79K | |
![[IMG]](/icons/image2.gif) | nord-fundacja.jpg | 2018-11-09 10:25 | 73K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW.jpg | 2018-11-13 10:48 | 76K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(1).jpg | 2018-11-13 10:57 | 72K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(2).jpg | 2018-11-13 11:06 | 155K | |
![[IMG]](/icons/image2.gif) | Obraz1(7).jpg | 2018-11-16 14:29 | 139K | |
![[IMG]](/icons/image2.gif) | Obraz1(8).jpg | 2018-11-16 14:29 | 139K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(3).jpg | 2018-11-17 16:33 | 29K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(4).jpg | 2018-11-18 19:27 | 136K | |
![[IMG]](/icons/image2.gif) | Irlandzka jesień A3 v4.jpg | 2018-11-22 22:45 | 6.4M | |
![[IMG]](/icons/image2.gif) | wykład 29 grudnia 2018 r.jpg | 2018-11-22 22:52 | 538K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(5).jpg | 2018-11-22 22:55 | 153K | |
![[ ]](/icons/unknown.gif) | MatchingGame.swf | 2018-12-02 22:22 | 40K | |
![[ ]](/icons/unknown.gif) | MatchingGame(1).swf | 2018-12-02 23:28 | 66K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(2).jpg | 2018-12-03 13:26 | 106K | |
![[IMG]](/icons/image2.gif) | Prezentacja1.jpg | 2018-12-05 22:57 | 79K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(6).jpg | 2018-12-05 22:58 | 33K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(3).jpg | 2018-12-10 13:12 | 157K | |
![[IMG]](/icons/image2.gif) | wykład 12 grudnia 2018 r (1).jpg | 2018-12-10 13:13 | 533K | |
![[IMG]](/icons/image2.gif) | program wykładów 2018-2019.jpg | 2018-12-10 13:14 | 5.5M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(4).jpg | 2018-12-10 14:35 | 108K | |
![[IMG]](/icons/image2.gif) | Tadeusz_Malinowski_eksponaty.jpg | 2018-12-14 14:06 | 603K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(5).jpg | 2018-12-14 14:08 | 23K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(6).jpg | 2018-12-20 13:51 | 179K | |
![[IMG]](/icons/image2.gif) | Sahara_plakat_internet.jpg | 2018-12-20 13:52 | 3.2M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(7).jpg | 2018-12-20 14:06 | 367K | |
![[IMG]](/icons/image2.gif) | Mrowino Inforgrafika.jpg | 2018-12-29 23:56 | 752K | |
![[IMG]](/icons/image2.gif) | Mrowino Inforgrafika(1).jpg | 2019-01-02 21:37 | 779K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(7).jpg | 2019-01-02 21:42 | 116K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(8).jpg | 2019-01-02 22:10 | 294K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(9).jpg | 2019-01-03 21:55 | 81K | |
![[IMG]](/icons/image2.gif) | Ulotka.jpg | 2019-01-03 21:56 | 1.5M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(10).jpg | 2019-01-03 22:03 | 69K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(11).jpg | 2019-01-04 13:16 | 81K | |
![[IMG]](/icons/image2.gif) | DSC_0190.JPG | 2019-01-08 01:55 | 6.2M | |
![[IMG]](/icons/image2.gif) | wykład 16 stycznia 2019 r.jpg | 2019-01-11 01:41 | 541K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(12).jpg | 2019-01-11 01:42 | 97K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW [Automatycznie zapisany].jpg | 2019-01-12 23:35 | 91K | |
![[IMG]](/icons/image2.gif) | 2(1).jpg | 2019-01-12 23:36 | 114K | |
![[IMG]](/icons/image2.gif) | Obraz2(3).jpg | 2019-01-12 23:37 | 147K | |
![[IMG]](/icons/image2.gif) | 06 Płytka z Gniezna fot. K. Zisopulu-Bleja.jpg | 2019-01-12 23:40 | 4.6M | |
![[IMG]](/icons/image2.gif) | 05 Sierp z Gniezna fot. K. Zisopulu-Bleja.jpg | 2019-01-12 23:40 | 2.3M | |
![[IMG]](/icons/image2.gif) | Obraz1.png | 2019-01-17 14:52 | 201K | |
![[IMG]](/icons/image2.gif) | wykład 18 stycznia.jpg | 2019-01-17 14:53 | 237K | |
![[ ]](/icons/layout.gif) | Prezentacja.pdf | 2019-01-17 22:48 | 8.6M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(8).jpg | 2019-01-17 22:52 | 257K | |
![[IMG]](/icons/image2.gif) | System obronny - okładka front 300 ppi.tif | 2019-01-18 01:05 | 6.0M | |
![[IMG]](/icons/image2.gif) | Obraz1(9).jpg | 2019-01-18 01:06 | 120K | |
![[IMG]](/icons/image2.gif) | NID-logotyp.jpg | 2019-01-18 01:11 | 253K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(9).jpg | 2019-01-21 13:00 | 156K | |
![[IMG]](/icons/image2.gif) | Plakat_Gniezno_MAP.jpg | 2019-01-23 01:19 | 2.0M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(10).jpg | 2019-01-23 22:55 | 163K | |
![[IMG]](/icons/image2.gif) | Obraz2(4).jpg | 2019-02-03 23:44 | 134K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(11).jpg | 2019-02-03 23:48 | 49K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(12).jpg | 2019-02-04 14:34 | 115K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(13).jpg | 2019-02-04 14:51 | 121K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(14).jpg | 2019-02-04 14:52 | 121K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(15).jpg | 2019-02-04 14:55 | 118K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(16).jpg | 2019-02-04 14:57 | 114K | |
![[IMG]](/icons/image2.gif) | banerek dla Muzeum.jpg | 2019-02-08 13:21 | 419K | |
![[ ]](/icons/unknown.gif) | Newsletter wzór.xps | 2019-02-09 23:20 | 1.7M | |
![[TXT]](/icons/text.gif) | Newsletter-wzór.html | 2019-02-09 23:38 | 17M | |
![[IMG]](/icons/image2.gif) | Obraz2(5).jpg | 2019-02-11 16:36 | 116K | |
![[TXT]](/icons/text.gif) | Newsletter-wzór(1).html | 2019-02-13 23:09 | 17M | |
![[IMG]](/icons/image2.gif) | Obraz1(10).jpg | 2019-02-15 11:42 | 549K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(17).jpg | 2019-02-17 22:25 | 174K | |
![[IMG]](/icons/image2.gif) | banner_600x193.jpg | 2019-02-17 22:27 | 96K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(18).jpg | 2019-02-28 15:09 | 132K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(19).jpg | 2019-03-10 18:08 | 77K | |
![[IMG]](/icons/image2.gif) | 53221724_1501593299975316_5458769730884075520_o.jpg | 2019-03-10 18:10 | 322K | |
![[IMG]](/icons/image2.gif) | Wykład 20.03.jpg | 2019-03-18 14:40 | 2.9M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(20).jpg | 2019-03-18 14:43 | 94K | |
![[IMG]](/icons/image2.gif) | kafel2.jpg | 2019-03-26 10:33 | 489K | |
![[IMG]](/icons/image2.gif) | plakat_Irlandia.jpg | 2019-03-26 10:34 | 2.3M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(21).jpg | 2019-03-26 10:39 | 155K | |
![[IMG]](/icons/image2.gif) | Mrowino_okładka_front_100ppi.jpg | 2019-03-27 16:08 | 296K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(22).jpg | 2019-04-02 07:36 | 200K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(23).jpg | 2019-04-10 11:58 | 48K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(24).jpg | 2019-04-16 00:02 | 131K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(25).jpg | 2019-04-16 16:51 | 131K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(26).jpg | 2019-04-17 22:12 | 45K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(27).jpg | 2019-04-18 14:16 | 368K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(28).jpg | 2019-04-18 14:27 | 121K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(29).jpg | 2019-04-24 09:52 | 60K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(30).jpg | 2019-04-24 12:13 | 209K | |
![[IMG]](/icons/image2.gif) | wykład 24 kwietnia (1).jpg | 2019-04-24 12:18 | 6.8M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(31).jpg | 2019-04-24 15:09 | 197K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(32).jpg | 2019-04-30 09:59 | 430K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(33).jpg | 2019-04-30 10:06 | 171K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(13).jpg | 2019-05-07 00:46 | 41K | |
![[IMG]](/icons/image2.gif) | wykład 15 maja.jpg | 2019-05-10 22:08 | 668K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(14).jpg | 2019-05-10 22:09 | 97K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(34).jpg | 2019-05-11 23:04 | 265K | |
![[IMG]](/icons/image2.gif) | wykład 12 czerwca.jpg | 2019-06-05 13:04 | 1.3M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(35).jpg | 2019-06-05 13:06 | 111K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(36).jpg | 2019-06-05 13:07 | 111K | |
![[ ]](/icons/layout.gif) | Herby, rody i rodziny.pdf | 2019-06-10 22:34 | 4.2M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(37).jpg | 2019-06-10 22:35 | 75K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(38).jpg | 2019-06-12 07:07 | 232K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(15).jpg | 2019-06-14 08:29 | 127K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(16).jpg | 2019-06-24 13:32 | 130K | |
![[IMG]](/icons/image2.gif) | Prezentacja1(1).jpg | 2019-07-03 17:53 | 146K | |
![[IMG]](/icons/image2.gif) | Prezentacja1(2).jpg | 2019-07-03 17:54 | 142K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(39).jpg | 2019-08-02 11:43 | 92K | |
![[IMG]](/icons/image2.gif) | Obraz1(11).jpg | 2019-08-02 11:46 | 1.9M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(40).jpg | 2019-09-10 11:46 | 65K | |
![[IMG]](/icons/image2.gif) | Obraz1(1).png | 2019-09-17 12:22 | 506K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(17).jpg | 2019-09-19 01:01 | 137K | |
![[IMG]](/icons/image2.gif) | plakat wystawa-strona001.png | 2019-09-19 01:03 | 1.8M | |
![[ ]](/icons/layout.gif) | program konferencji.pdf | 2019-09-19 01:06 | 380K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(41).jpg | 2019-10-14 10:28 | 73K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(18).jpg | 2019-10-22 22:22 | 193K | |
![[IMG]](/icons/image2.gif) | wykład 25 października.jpg | 2019-10-22 22:23 | 1.7M | |
![[IMG]](/icons/image2.gif) | 02_19_00000187_PZW_banner_B2C_1080 x 1080px.jpg | 2019-10-26 22:59 | 842K | |
![[IMG]](/icons/image2.gif) | 02_19_00000187_PZW_banner_B2C_125 x 125px.jpg | 2019-10-26 23:02 | 33K | |
![[IMG]](/icons/image2.gif) | 02_19_00000187_PZW_banner_B2C_1200x900px.jpg | 2019-10-26 23:03 | 840K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(42).jpg | 2019-11-04 12:03 | 112K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(43).jpg | 2019-11-05 10:08 | 199K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(44).jpg | 2019-11-06 13:52 | 146K | |
![[IMG]](/icons/image2.gif) | Pierścień z Grzybowa-1.jpg | 2019-11-06 13:57 | 4.3M | |
![[IMG]](/icons/image2.gif) | Pierścień z Grzybowa-1(1).jpg | 2019-11-06 13:58 | 4.3M | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(45).jpg | 2019-11-18 20:36 | 168K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(46).jpg | 2019-11-19 18:52 | 282K | |
![[IMG]](/icons/image2.gif) | 78964031_2621035037943784_3419725064986165248_o.jpg | 2019-11-28 23:01 | 81K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(19).jpg | 2019-11-28 23:03 | 53K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(20).jpg | 2019-11-28 23:07 | 51K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka do robienia ikon wpisu(47).jpg | 2019-12-05 15:10 | 255K | |
![[IMG]](/icons/image2.gif) | Fot. 2.jpg | 2019-12-05 15:27 | 787K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(21).jpg | 2019-12-08 23:45 | 151K | |
![[IMG]](/icons/image2.gif) | Cennik 001.jpg | 2019-12-17 06:53 | 346K | |
![[IMG]](/icons/image2.gif) | Cennik 002.jpg | 2019-12-17 06:56 | 109K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(22).jpg | 2019-12-21 22:44 | 426K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(23).jpg | 2019-12-21 22:50 | 334K | |
![[IMG]](/icons/image2.gif) | Ferie 2020_cegiełka na stronę www.jpg | 2020-01-03 22:19 | 297K | |
![[IMG]](/icons/image2.gif) | Ferie 2020_plakat.jpg | 2020-01-03 22:27 | 12M | |
![[ ]](/icons/unknown.gif) | Dąbrówka koło Poznania.pptx | 2020-01-07 22:34 | 12M | |
![[ ]](/icons/unknown.gif) | Dąbrówka koło Poznania(1).pptx | 2020-01-07 22:35 | 12M | |
![[IMG]](/icons/image2.gif) | Dąbrówka koło Poznania - infografika.jpg | 2020-01-07 22:36 | 736K | |
![[IMG]](/icons/image2.gif) | Atofri.jpg | 2020-01-10 00:44 | 79K | |
![[IMG]](/icons/image2.gif) | Dąbrówka koło Poznania [13.01.19].jpg | 2020-01-14 17:56 | 760K | |
![[IMG]](/icons/image2.gif) | Dąbrówka koło Poznania [15.01.20].jpg | 2020-01-15 22:19 | 759K | |
![[IMG]](/icons/image2.gif) | Legenda o Piastowskiej Matce Królów.jpg | 2020-01-22 15:10 | 112K | |
![[IMG]](/icons/image2.gif) | Przyroda Warta Poznania 2020.jpg | 2020-01-23 23:53 | 109K | |
![[IMG]](/icons/image2.gif) | Rzeźba wału Genius.jpg | 2020-01-28 14:00 | 161K | |
![[IMG]](/icons/image2.gif) | ivfkvb.jpg | 2020-02-18 12:24 | 12K | |
![[IMG]](/icons/image2.gif) | oljgoil.jpg | 2020-02-18 12:25 | 6.7K | |
![[IMG]](/icons/image2.gif) | Dąbrówka Promo.jpg | 2020-02-19 13:06 | 56K | |
![[IMG]](/icons/image2.gif) | Dąbrówka promo plakat.jpg | 2020-02-19 13:07 | 191K | |
![[IMG]](/icons/image2.gif) | na str www.jpg | 2020-02-19 14:40 | 727K | |
![[IMG]](/icons/image2.gif) | na str www(1).jpg | 2020-02-19 14:41 | 727K | |
![[IMG]](/icons/image2.gif) | ks logo map.jpg | 2020-02-19 17:50 | 119K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(25).jpg | 2020-02-19 17:57 | 122K | |
![[IMG]](/icons/image2.gif) | wykład 26 lutego 2020 r.jpg | 2020-02-19 22:31 | 626K | |
![[IMG]](/icons/image2.gif) | Catal.jpg | 2020-02-19 22:35 | 93K | |
![[IMG]](/icons/image2.gif) | wykład 20 lutego 2020 r.jpg | 2020-02-20 00:21 | 682K | |
![[IMG]](/icons/image2.gif) | huyuk.jpg | 2020-02-20 00:24 | 121K | |
![[ ]](/icons/layout.gif) | Dąbrówka Prezentacja (28.02.2020).pdf | 2020-02-28 12:19 | 3.0M | |
![[IMG]](/icons/image2.gif) | safe_image.jpg | 2020-03-17 15:32 | 22K | |
![[IMG]](/icons/image2.gif) | Aplikacja.jpg | 2020-03-17 15:40 | 76K | |
![[IMG]](/icons/image2.gif) | zilone_muzeum.jpg | 2020-03-17 21:13 | 4.3M | |
![[IMG]](/icons/image2.gif) | zielone_muzeum_2.jpg | 2020-03-17 21:15 | 3.7M | |
![[IMG]](/icons/image2.gif) | giessen1_big.jpg.original.jpg | 2020-03-30 16:24 | 39K | |
![[IMG]](/icons/image2.gif) | Matma.jpg | 2020-03-30 16:30 | 123K | |
![[IMG]](/icons/image2.gif) | Skanowanie XYZ.png | 2020-04-10 21:32 | 29K | |
![[IMG]](/icons/image2.gif) | Kolekcje pozaeuropejskie.jpg | 2020-04-26 22:30 | 247K | |
![[IMG]](/icons/image2.gif) | HISTORIA MUZEUM.png | 2020-05-12 20:14 | 3.0M | |
![[IMG]](/icons/image2.gif) | Wirtualny Spacer.png | 2020-05-12 22:49 | 3.0M | |
![[IMG]](/icons/image2.gif) | KAfle.png | 2020-05-13 09:33 | 1.2M | |
![[IMG]](/icons/image2.gif) | Pałac Górków.png | 2020-05-13 13:37 | 3.0M | |
![[IMG]](/icons/image2.gif) | Wirtualny SPACER PO Dziedzińcu.png | 2020-05-13 13:42 | 3.1M | |
![[IMG]](/icons/image2.gif) | -,pic1,1200,147547,263235,with-ratio,16_9.jpg | 2020-05-27 09:17 | 62K | |
![[IMG]](/icons/image2.gif) | Egipski Sen.png | 2020-06-03 11:43 | 1.6M | |
![[IMG]](/icons/image2.gif) | Hieroglify.png | 2020-06-05 23:22 | 1.3M | |
![[IMG]](/icons/image2.gif) | Nagroda w konkursie PTPN.jpg | 2020-06-24 23:31 | 182K | |
![[IMG]](/icons/image2.gif) | Nominacja.jpg | 2020-06-24 23:33 | 1.0M | |
![[IMG]](/icons/image2.gif) | Brązowa Ryczka.jpg | 2020-07-01 14:52 | 254K | |
![[IMG]](/icons/image2.gif) | Zdrowie i higiena - ikona wpisu.jpg | 2020-07-01 17:28 | 62K | |
![[IMG]](/icons/image2.gif) | Belka zdrowie i higiena.png | 2020-07-01 17:30 | 108K | |
![[IMG]](/icons/image2.gif) | 106990352_1476219259252070_5960915380160471788_n.jpg | 2020-07-06 14:00 | 48K | |
![[IMG]](/icons/image2.gif) | 00179.jpg | 2020-08-15 11:50 | 422K | |
![[IMG]](/icons/image2.gif) | MATEUSZ WYCZÓŁKOWSKI, PAŁAC W SZYPŁOWIE, olej na płótnie, 60X80cm.JPG | 2020-08-31 09:56 | 1.3M | |
![[IMG]](/icons/image2.gif) | Biały kwadrat.jpg | 2020-09-09 13:30 | 10K | |
![[IMG]](/icons/image2.gif) | Biały kwadrat(1).jpg | 2020-09-09 13:30 | 10K | |
![[IMG]](/icons/image2.gif) | Sztuka naskalna.jpg | 2020-09-21 21:22 | 293K | |
![[IMG]](/icons/image2.gif) | 0002 Genius- Blask(1).jpg | 2020-09-29 11:08 | 62K | |
![[IMG]](/icons/image2.gif) | 03 Rez.jpg | 2020-09-29 11:10 | 115K | |
![[IMG]](/icons/image2.gif) | FB - 1.jpg | 2020-09-29 11:11 | 1.8M | |
![[IMG]](/icons/image2.gif) | Ostrów Tumski Międzynarodowy Dzień Muzyki 2020.jpg | 2020-09-30 15:03 | 115K | |
![[IMG]](/icons/image2.gif) | Międzynarodowy dzień muzyki Ostrów Tumski 2020.jpg | 2020-09-30 15:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | Fot 01 - Tomasz Siwiński - Nawiązania, technika własna.JPG | 2020-10-14 13:24 | 701K | |
![[IMG]](/icons/image2.gif) | P1230076.JPG | 2020-10-16 10:55 | 9.1M | |
![[IMG]](/icons/image2.gif) | Wystawa Sztuka.jpg | 2020-10-20 11:39 | 141K | |
![[IMG]](/icons/image2.gif) | wyst sztuk.jpg | 2020-10-20 11:42 | 177K | |
![[IMG]](/icons/image2.gif) | wyst sztuk(1).jpg | 2020-10-20 11:43 | 177K | |
![[IMG]](/icons/image2.gif) | Archeologia i sztuka - plakat ekspozycji.jpg | 2020-10-20 12:07 | 470K | |
![[IMG]](/icons/image2.gif) | Samhain 2020.jpg | 2020-11-02 22:18 | 53K | |
![[IMG]](/icons/image2.gif) | Samhain v2.png | 2020-11-02 22:20 | 867K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka WWW(24).jpg | 2020-11-02 22:27 | 75K | |
![[IMG]](/icons/image2.gif) | plakat_strona_MAP.png | 2020-11-24 11:54 | 1.7M | |
![[IMG]](/icons/image2.gif) | plakat_strona_MAP.jpg | 2020-11-24 11:59 | 141K | |
![[IMG]](/icons/image2.gif) | plakat_FB_MAP.png | 2020-11-24 12:02 | 3.3M | |
![[IMG]](/icons/image2.gif) | Pamieci Wojtciecha Dzieduszyckiego-2.jpg | 2020-12-01 12:48 | 2.2M | |
![[IMG]](/icons/image2.gif) | Karta zadań_projekt_1_Genius Loci-01-01 (2).png | 2020-12-01 13:49 | 5.4M | |
![[IMG]](/icons/image2.gif) | Ensemble Passato.jpg | 2021-01-03 05:51 | 99K | |
![[IMG]](/icons/image2.gif) | Dusze z Buto i Hierakonpolis.jpg | 2021-01-11 22:15 | 109K | |
![[ ]](/icons/layout.gif) | DZIEJE STAROŻYTNEGO EGIPTU.pdf | 2021-01-11 22:16 | 1.9M | |
![[IMG]](/icons/image2.gif) | Chronologia.jpg | 2021-01-11 22:55 | 79K | |
![[ ]](/icons/layout.gif) | Chronologia starożytnego Egiptu (1).pdf | 2021-01-11 22:56 | 227K | |
![[IMG]](/icons/image2.gif) | plakat_MAP_2-01.jpg | 2021-01-31 23:38 | 173K | |
![[IMG]](/icons/image2.gif) | Departments_e.jpg | 2021-02-12 11:41 | 102K | |
![[IMG]](/icons/image2.gif) | Ceremonia wręczenia odznaczenia dr Polyxeni Adam-Veleni.jpg | 2021-02-27 21:30 | 67K | |
![[IMG]](/icons/image2.gif) | Wielkanoc_plakat str. MAP.jpg | 2021-03-14 21:10 | 317K | |
![[IMG]](/icons/image2.gif) | Plakat_Mieszko i Dobrawa_str. MAP.jpg | 2021-03-31 15:26 | 535K | |
![[IMG]](/icons/image2.gif) | Rozmiarówka Baner Rezerwat.jpg | 2021-04-15 12:25 | 115K | |
![[IMG]](/icons/image2.gif) | Prezentacja1(3).jpg | 2021-05-15 15:48 | 125K | |
![[IMG]](/icons/image2.gif) | KAFELEK NA STRONIE -M. Osypińska.jpg | 2021-05-18 19:12 | 144K | |
![[IMG]](/icons/image2.gif) | Zrzut ekranu 2021-05-21 063655.jpg | 2021-05-21 06:37 | 92K | |
![[IMG]](/icons/image2.gif) | Owieczki.jpg | 2021-05-21 06:38 | 185K | |
![[IMG]](/icons/image2.gif) | KAFELEK NA STRONIE - Ląd.jpg | 2021-05-26 12:39 | 170K | |
![[ ]](/icons/layout.gif) | Ląd - Tradycja i nowoczesność (całość, zmniejszony).pdf | 2021-05-26 12:54 | 5.4M | |
![[IMG]](/icons/image2.gif) | KAFELEK NA STRONIE -PDF.jpg | 2021-05-26 13:03 | 70K | |
![[IMG]](/icons/image2.gif) | A ziółk.jpg | 2021-06-10 16:38 | 103K | |
![[IMG]](/icons/image2.gif) | wykład 17 czerwca.jpg | 2021-06-10 16:38 | 4.8M | |
![[IMG]](/icons/image2.gif) | logoNIDpoziomPL.png | 2021-06-15 13:07 | 190K | |
![[IMG]](/icons/image2.gif) | Zaszczepieni.jpg | 2021-06-16 09:28 | 89K | |
![[IMG]](/icons/image2.gif) | Gostylla.jpg | 2021-06-16 11:26 | 125K | |
![[IMG]](/icons/image2.gif) | Gostylla(1).jpg | 2021-06-16 11:31 | 174K | |
![[IMG]](/icons/image2.gif) | Gostylla Pałucka Biogram.jpg | 2021-06-23 12:56 | 143K | |
![[IMG]](/icons/image2.gif) | Program.jpg | 2021-08-17 14:22 | 47K | |
![[IMG]](/icons/image2.gif) | PLAKAT FESTIWAL 2021 logotypy.jpg | 2021-08-17 14:25 | 13M | |
![[IMG]](/icons/image2.gif) | Festiwal Teatrów Podwórkowych.jpg | 2021-08-17 14:27 | 92K | |
![[IMG]](/icons/image2.gif) | Weekend Seniora_FB_4.png | 2021-08-24 20:22 | 1.3M | |
![[IMG]](/icons/image2.gif) | _DSC4930 1 (1).jpg | 2021-09-02 14:28 | 506K | |
![[IMG]](/icons/image2.gif) | Duet Kurkowicz Braszak.jpg | 2021-09-02 14:32 | 572K | |
![[IMG]](/icons/image2.gif) | Zmiana terminu warsztatów.jpg | 2021-09-13 13:42 | 149K | |
![[IMG]](/icons/image2.gif) | twitter_100s_post_1024x512.jpg | 2021-09-22 22:32 | 197K | |
![[IMG]](/icons/image2.gif) | fb_100s_post_1200x900.jpg | 2021-09-22 22:34 | 374K | |
![[IMG]](/icons/image2.gif) | NCN NAgroda.jpg | 2021-10-06 17:55 | 165K | |
![[IMG]](/icons/image2.gif) | NCN.jpg | 2021-10-06 17:56 | 173K | |
![[IMG]](/icons/image2.gif) | Polkowski_bio-300x200_2.jpg | 2021-10-20 08:50 | 34K | |
![[IMG]](/icons/image2.gif) | Samhain.jpg | 2021-10-26 11:10 | 36K | |
![[IMG]](/icons/image2.gif) | plakat samhain 2021 A4 png.png | 2021-10-26 11:12 | 6.0M | |
![[IMG]](/icons/image2.gif) | Scythian.jpg | 2021-10-26 21:04 | 280K | |
![[IMG]](/icons/image2.gif) | Karta zadań_projekt_2_Genius Loci.jpg | 2021-10-28 21:05 | 208K | |
![[IMG]](/icons/image2.gif) | Karta zadań_projekt_2_Genius Loci(1).jpg | 2021-10-28 21:06 | 208K | |
![[IMG]](/icons/image2.gif) | IMG_20211027_113100.jpg | 2021-10-28 22:03 | 5.0M | |
![[IMG]](/icons/image2.gif) | North_American_hunters.jpg | 2021-10-29 11:33 | 151K | |
![[IMG]](/icons/image2.gif) | 02 Mikołajki.jpg | 2021-11-10 16:05 | 272K | |
![[IMG]](/icons/image2.gif) | DSC_0011.JPG | 2021-11-10 16:09 | 11M | |
![[IMG]](/icons/image2.gif) | T. Skorupka Spotkanie.jpg | 2021-11-10 18:23 | 124K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_plakat FB.png | 2021-11-10 18:26 | 3.3M | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_plakat FB(1).png | 2021-11-10 18:31 | 3.3M | |
![[SND]](/icons/sound2.gif) | 04_AD komiks lodowiec____ZMONTOWANE.mp3 | 2021-11-23 13:44 | 15M | |
![[SND]](/icons/sound2.gif) | 05_AD komiks muzeum____ZMONTOWANE.mp3 | 2021-11-23 13:44 | 12M | |
![[SND]](/icons/sound2.gif) | 06_AD komiks tworcy____ZMONTOWANE.mp3 | 2021-11-23 13:44 | 15M | |
![[IMG]](/icons/image2.gif) | 257658143_4536345333115960_7525388437661405431_n.jpg | 2021-11-23 22:44 | 522K | |
![[IMG]](/icons/image2.gif) | 42e2d48d (1).png | 2021-11-24 07:19 | 117K | |
![[IMG]](/icons/image2.gif) | Ferie 2022_plakat strona MAP.png | 2021-12-15 20:27 | 668K | |
![[IMG]](/icons/image2.gif) | Ferie.jpg | 2021-12-15 20:31 | 130K | |
![[IMG]](/icons/image2.gif) | Życzenia świąteczne -3.jpg | 2021-12-21 15:09 | 1.8M | |
![[IMG]](/icons/image2.gif) | Życzenia świąteczne.jpg | 2021-12-21 15:15 | 83K | |
![[IMG]](/icons/image2.gif) | Obraz4(2).jpg | 2022-01-03 23:03 | 143K | |
![[IMG]](/icons/image2.gif) | Wędrówki ludów nad małą Wartą.jpg | 2022-01-11 13:44 | 82K | |
![[IMG]](/icons/image2.gif) | Plakat_WLNMW.png | 2022-01-11 13:49 | 324K | |
![[IMG]](/icons/image2.gif) | Kafel-wpisuWLNMW.jpg | 2022-01-11 15:42 | 126K | |
![[IMG]](/icons/image2.gif) | IMG_0108.png | 2022-01-21 17:19 | 902K | |
![[IMG]](/icons/image2.gif) | IMG_0139.png | 2022-01-21 17:19 | 1.0M | |
![[IMG]](/icons/image2.gif) | IMG_0086.png | 2022-01-21 17:19 | 789K | |
![[IMG]](/icons/image2.gif) | IMG_0126.png | 2022-01-21 17:19 | 866K | |
![[IMG]](/icons/image2.gif) | IMG_0129.png | 2022-01-21 17:19 | 715K | |
![[IMG]](/icons/image2.gif) | IMG_0124.png | 2022-01-21 17:19 | 648K | |
![[IMG]](/icons/image2.gif) | IMG_0100.png | 2022-01-21 17:19 | 308K | |
![[IMG]](/icons/image2.gif) | IMG_0078.png | 2022-01-21 17:19 | 795K | |
![[IMG]](/icons/image2.gif) | IMG_0099.png | 2022-01-21 17:19 | 1.0M | |
![[IMG]](/icons/image2.gif) | IMG_0115.png | 2022-01-21 17:19 | 899K | |
![[IMG]](/icons/image2.gif) | IMG_0122.png | 2022-01-21 17:19 | 700K | |
![[IMG]](/icons/image2.gif) | IMG_0125.png | 2022-01-21 17:19 | 1.1M | |
![[IMG]](/icons/image2.gif) | IMG_0079.png | 2022-01-21 17:19 | 919K | |
![[IMG]](/icons/image2.gif) | IMG_0117.png | 2022-01-21 17:19 | 840K | |
![[IMG]](/icons/image2.gif) | Film o Rezerwacie w TVP Historia.jpg | 2022-01-27 21:15 | 58K | |
![[ ]](/icons/layout.gif) | Śrem prezentacja multimedialna .pdf | 2022-02-04 14:35 | 5.5M | |
![[IMG]](/icons/image2.gif) | Śrem Infografika.jpg | 2022-02-04 14:37 | 1.0M | |
![[IMG]](/icons/image2.gif) | flaga ukraina.png | 2022-02-25 09:53 | 684 | |
![[IMG]](/icons/image2.gif) | flaga ukrainy2.jpg | 2022-02-25 09:59 | 5.3K | |
![[IMG]](/icons/image2.gif) | flaga ukraina3.jpeg | 2022-02-25 10:06 | 158K | |
![[IMG]](/icons/image2.gif) | Warsztaty dla dzieci z Ukrainy.jpg | 2022-03-02 11:17 | 128K | |
![[IMG]](/icons/image2.gif) | Foldery w języku ukraińskim.jpg | 2022-03-02 18:07 | 161K | |
![[IMG]](/icons/image2.gif) | Warsztaty w słońcu starożytnego egiptu.jpg | 2022-03-02 21:40 | 91K | |
![[IMG]](/icons/image2.gif) | Zdjęcie w tle FB.jpg | 2022-03-02 21:44 | 188K | |
![[IMG]](/icons/image2.gif) | Pomoc humanitarna IG.jpg | 2022-03-02 21:47 | 245K | |
![[IMG]](/icons/image2.gif) | Dzieła, twórcy, fundatorzy - publikacja.jpg | 2022-03-04 22:45 | 140K | |
![[IMG]](/icons/image2.gif) | Dni św Patrzyka 2022.jpg | 2022-03-08 08:41 | 104K | |
![[IMG]](/icons/image2.gif) | Lech Krzyżaniak Wystawa 2022 ikona wpisu.jpg | 2022-03-08 08:59 | 159K | |
![[IMG]](/icons/image2.gif) | Lech Krzyżaniak Wystawa 2022.jpg | 2022-03-08 09:04 | 321K | |
![[IMG]](/icons/image2.gif) | kafelek_bilet_1.jpg | 2022-03-08 09:26 | 94K | |
![[IMG]](/icons/image2.gif) | Wystawa Made in Kiyev odwołana.jpg | 2022-03-09 12:32 | 42K | |
![[ ]](/icons/layout.gif) | Irlandzka gra wersja do zawieszenia na stronie (2) (1).pdf | 2022-03-10 15:01 | 583K | |
![[IMG]](/icons/image2.gif) | Na pomoc Ukrainie.jpg | 2022-03-11 22:14 | 92K | |
![[IMG]](/icons/image2.gif) | Warsztaty w starożytnej Mezopotamii.jpg | 2022-03-11 22:42 | 159K | |
![[ ]](/icons/unknown.gif) | IMG_2939.jfif | 2022-03-12 22:03 | 4.5M | |
![[IMG]](/icons/image2.gif) | Mapa dotarcia do GEnius Loci.jpg | 2022-03-12 22:07 | 53K | |
![[ ]](/icons/layout.gif) | InformatorUA 3 (2).pdf | 2022-03-12 22:20 | 3.9M | |
![[ ]](/icons/compressed.gif) | dongiovannimateriaynastron.zip | 2022-03-15 10:10 | 1.1M | |
![[IMG]](/icons/image2.gif) | DON GIOVANNI #feminista (2).png | 2022-03-15 10:12 | 649K | |
![[IMG]](/icons/image2.gif) | Ląd Festiwal STrona Oficjalna.jpg | 2022-03-17 08:41 | 54K | |
![[IMG]](/icons/image2.gif) | cropped-logo-festiwal.png | 2022-03-17 22:44 | 12K | |
![[IMG]](/icons/image2.gif) | Warsztaty w siecie megalitów.jpg | 2022-03-17 23:46 | 118K | |
![[IMG]](/icons/image2.gif) | Książki w języku ukraińskim i rosyjskim.jpg | 2022-03-20 16:59 | 324K | |
![[IMG]](/icons/image2.gif) | IMG_20220319_160537.jpg | 2022-03-20 17:44 | 4.3M | |
![[IMG]](/icons/image2.gif) | Slon_Trabibombi_2022_Teatr_Atofri_slajder.jpg | 2022-03-23 11:45 | 126K | |
![[IMG]](/icons/image2.gif) | Wrastzaty Ukraina Ptaki.jpg | 2022-03-25 15:04 | 276K | |
![[IMG]](/icons/image2.gif) | Malowidła Ukraina.jpg | 2022-03-28 15:35 | 167K | |
![[IMG]](/icons/image2.gif) | ArcheoAid.jpg | 2022-04-04 23:23 | 48K | |
![[IMG]](/icons/image2.gif) | Warsztaty Ukr Muzyka.jpg | 2022-04-12 14:59 | 239K | |
![[ ]](/icons/layout.gif) | Formularz wniosku.pdf | 2022-04-14 10:16 | 184K | |
![[IMG]](/icons/image2.gif) | Święta.png | 2022-04-14 14:55 | 3.5M | |
![[IMG]](/icons/image2.gif) | Święta(1).png | 2022-04-14 14:55 | 3.5M | |
![[IMG]](/icons/image2.gif) | Święta.png.jpg | 2022-04-14 14:56 | 106K | |
![[IMG]](/icons/image2.gif) | Pisankowe warsztaty.jpg | 2022-04-20 13:21 | 112K | |
![[IMG]](/icons/image2.gif) | Lekcje po ukraińsku.png | 2022-04-21 13:23 | 13M | |
![[IMG]](/icons/image2.gif) | L ukr.jpg | 2022-04-21 13:25 | 653K | |
![[IMG]](/icons/image2.gif) | L ukr(1).jpg | 2022-04-21 13:53 | 1.3M | |
![[IMG]](/icons/image2.gif) | Pomagam element.png | 2022-04-21 14:19 | 227K | |
![[IMG]](/icons/image2.gif) | pOMKA.jpg | 2022-04-21 14:20 | 62K | |
![[IMG]](/icons/image2.gif) | NM_sociale_2022_kafle-04.png | 2022-04-21 23:47 | 1.0M | |
![[IMG]](/icons/image2.gif) | NM_HD.jpg | 2022-04-21 23:48 | 435K | |
![[IMG]](/icons/image2.gif) | NM2022.jpg | 2022-04-21 23:51 | 279K | |
![[VID]](/icons/movie.gif) | Noc Muzeów.mp4 | 2022-04-22 00:02 | 12M | |
![[IMG]](/icons/image2.gif) | Klimenko Niebieski.jpg | 2022-05-17 10:20 | 147K | |
![[IMG]](/icons/image2.gif) | Klimenko żółty.jpg | 2022-05-17 10:20 | 106K | |
![[IMG]](/icons/image2.gif) | 281288230_1344762485991125_1161806634997153995_n.png | 2022-05-17 12:58 | 182K | |
![[IMG]](/icons/image2.gif) | Wydarzenie FB Gry Planszowe na Dni Rodziny.jpg | 2022-05-17 13:00 | 303K | |
![[IMG]](/icons/image2.gif) | PDR 2022.jpg | 2022-05-17 13:02 | 76K | |
![[IMG]](/icons/image2.gif) | image003.jpg | 2022-05-27 20:48 | 7.0K | |
![[ ]](/icons/unknown.gif) | EFSI_Samorzad_kolor.jfif | 2022-05-27 20:52 | 448K | |
![[IMG]](/icons/image2.gif) | Baner TU.jpg | 2022-05-27 20:55 | 127K | |
![[IMG]](/icons/image2.gif) | footer-eu.png | 2022-05-27 21:12 | 136K | |
![[IMG]](/icons/image2.gif) | Baner TU 2.jpg | 2022-05-30 09:41 | 126K | |
![[IMG]](/icons/image2.gif) | footer-eu dobry.png | 2022-05-30 09:57 | 209K | |
![[ ]](/icons/unknown.gif) | IMG_1392.jfif | 2022-05-30 21:43 | 15M | |
![[IMG]](/icons/image2.gif) | Unia Europejska Flaga.png | 2022-05-31 09:10 | 1.3K | |
![[IMG]](/icons/image2.gif) | DON GIOVANNI #feminista (2)(1).png | 2022-06-07 08:16 | 649K | |
![[IMG]](/icons/image2.gif) | DON GIOVANNI #feminista (2)(2).png | 2022-06-07 08:17 | 649K | |
![[ ]](/icons/layout.gif) | DON GIOVANNI nowe.pdf | 2022-06-07 08:26 | 523K | |
![[IMG]](/icons/image2.gif) | FB_IMG_1654585698829.jpg | 2022-06-07 09:16 | 30K | |
![[IMG]](/icons/image2.gif) | FB_IMG_1654585769592.jpg | 2022-06-07 09:22 | 122K | |
![[IMG]](/icons/image2.gif) | Bednarczuk.jpg | 2022-06-08 20:13 | 342K | |
![[IMG]](/icons/image2.gif) | Anna Bednarczuk.jpg | 2022-06-08 20:18 | 206K | |
![[IMG]](/icons/image2.gif) | Dino Ukr.jpg | 2022-06-08 22:28 | 64K | |
![[IMG]](/icons/image2.gif) | A Krzemińska.jpg | 2022-06-08 22:45 | 39K | |
![[IMG]](/icons/image2.gif) | EDA 2022.jpg | 2022-06-14 16:44 | 117K | |
![[IMG]](/icons/image2.gif) | Awarowie Tło.jpg | 2022-06-16 08:17 | 301K | |
![[IMG]](/icons/image2.gif) | Agatha_Christie_and_Max_Mallowan_in_1950.png | 2022-06-18 14:36 | 1.1M | |
![[IMG]](/icons/image2.gif) | LAM 2020 grafika.JPG | 2022-06-20 12:35 | 125K | |
![[IMG]](/icons/image2.gif) | Weekend na szlaku piastowskim.jpg | 2022-06-21 20:19 | 99K | |
![[IMG]](/icons/image2.gif) | 283689385_5238721212841807_2848419526034849436_n.jpg | 2022-06-22 13:18 | 97K | |
![[IMG]](/icons/image2.gif) | Zajawka2.jpg | 2022-06-22 21:57 | 949K | |
![[IMG]](/icons/image2.gif) | SPacer NMP Tło.png | 2022-06-22 22:57 | 1.3M | |
![[IMG]](/icons/image2.gif) | Gra muzealna W poszukiwaniu skarbów faraona.jpg | 2022-06-27 11:20 | 110K | |
![[IMG]](/icons/image2.gif) | 290021594_395423329292967_3269009015715833159_n.jpg | 2022-06-29 15:03 | 1.2M | |
![[IMG]](/icons/image2.gif) | IMG_1123.JPG | 2022-07-16 08:12 | 11M | |
![[IMG]](/icons/image2.gif) | Tut.jpg | 2022-07-20 10:43 | 212K | |
![[IMG]](/icons/image2.gif) | Pocztówki.jpg | 2022-07-26 13:48 | 169K | |
![[IMG]](/icons/image2.gif) | 291498521_1670945849941205_2868102462825392478_n.png | 2022-07-27 14:21 | 3.9M | |
![[IMG]](/icons/image2.gif) | 281049448_688581122419260_408120644702517236_n.png | 2022-07-27 14:21 | 62K | |
![[IMG]](/icons/image2.gif) | Klub Anubis.jpg | 2022-07-27 14:25 | 62K | |
![[IMG]](/icons/image2.gif) | FB KLub.jpg | 2022-07-27 14:32 | 15K | |
![[IMG]](/icons/image2.gif) | BFAP 27.jpg | 2022-07-28 22:30 | 49K | |
![[IMG]](/icons/image2.gif) | Sponsorzy BFAP 27 Belka.jpg | 2022-07-29 12:47 | 72K | |
![[IMG]](/icons/image2.gif) | Gra z Teatrem.jpg | 2022-08-26 19:21 | 168K | |
![[ ]](/icons/layout.gif) | oswiadczenie radiologiczne.pdf | 2022-08-29 13:27 | 112K | |
![[ ]](/icons/unknown.gif) | Weeekend Seniora z Kulturą 2022.pptx | 2022-08-30 06:27 | 3.1M | |
![[IMG]](/icons/image2.gif) | Weeekend Seniora z Kulturą 2022.jpg | 2022-08-30 06:28 | 107K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o... www.jpg | 2022-08-30 08:32 | 99K | |
![[IMG]](/icons/image2.gif) | glass-building-outline-panorama.jpeg | 2022-08-31 21:18 | 498K | |
![[IMG]](/icons/image2.gif) | fantastyczne zwierzęta (1).jpg | 2022-09-07 06:07 | 324K | |
![[IMG]](/icons/image2.gif) | P1520527.JPG | 2022-09-07 10:35 | 5.6M | |
![[IMG]](/icons/image2.gif) | P1520527(1).JPG | 2022-09-07 10:36 | 5.6M | |
![[IMG]](/icons/image2.gif) | P1520523.JPG | 2022-09-07 10:36 | 5.3M | |
![[IMG]](/icons/image2.gif) | Łazarski od spodu.jpg | 2022-09-07 10:38 | 97K | |
![[IMG]](/icons/image2.gif) | Klub Anubis(1).jpg | 2022-09-07 12:06 | 217K | |
![[IMG]](/icons/image2.gif) | 305024898_846512782997762_3741512508952612813_n.png | 2022-09-07 12:06 | 1.2M | |
![[IMG]](/icons/image2.gif) | 511-2014.JPG | 2022-09-07 15:27 | 4.2M | |
![[IMG]](/icons/image2.gif) | Spotk z hier.jpg | 2022-09-12 10:23 | 111K | |
![[IMG]](/icons/image2.gif) | Ok Poznań Baner.jpg | 2022-09-12 12:30 | 104K | |
![[IMG]](/icons/image2.gif) | Ok Poznań Baner(1).jpg | 2022-09-12 12:33 | 73K | |
![[IMG]](/icons/image2.gif) | Dodatkowa 2 (3).JPG | 2022-09-27 09:09 | 4.0M | |
![[IMG]](/icons/image2.gif) | festiwal.jpg | 2022-10-04 12:17 | 259K | |
![[IMG]](/icons/image2.gif) | Warsztaty Ukraina.jpg | 2022-10-10 10:23 | 1.2M | |
![[IMG]](/icons/image2.gif) | wykład 19 października.jpg | 2022-10-14 06:16 | 3.2M | |
![[IMG]](/icons/image2.gif) | Tuts_Tomb_Opened (1).jpg | 2022-10-15 05:51 | 204K | |
![[IMG]](/icons/image2.gif) | The_Roses_of_Heliogabalus (1).jpg | 2022-10-18 10:46 | 898K | |
![[IMG]](/icons/image2.gif) | Monumentalne grobowce z epoki kamienia.jpg | 2022-10-20 06:11 | 231K | |
![[IMG]](/icons/image2.gif) | Quadro.jpg | 2022-10-21 13:30 | 146K | |
![[IMG]](/icons/image2.gif) | SKały w ruchu katalog.jpg | 2022-10-21 15:04 | 125K | |
![[IMG]](/icons/image2.gif) | Fot. 2 Tomasz Skorupka - Zdjęcie ptaków.jpg | 2022-10-25 05:52 | 899K | |
![[IMG]](/icons/image2.gif) | 312374725_600834848550010_7342144061647402357_n.jpg | 2022-11-01 09:12 | 55K | |
![[IMG]](/icons/image2.gif) | 1780_klisze.jpg | 2022-11-02 13:46 | 1.3M | |
![[IMG]](/icons/image2.gif) | 01_znak_podstawowy_kolor_biale_tlo.png | 2022-11-02 13:47 | 70K | |
![[IMG]](/icons/image2.gif) | Demony warsztaty.jpg | 2022-11-16 13:39 | 191K | |
![[IMG]](/icons/image2.gif) | 315882849_6016821551662638_9054917681371428676_n (3).jpg | 2022-11-16 13:41 | 47K | |
![[IMG]](/icons/image2.gif) | prof. A.M. Wyrwa_fot_Piotr Namiota.jpg | 2022-11-17 15:05 | 505K | |
![[IMG]](/icons/image2.gif) | Unicef.jpg | 2022-11-18 13:54 | 38K | |
![[IMG]](/icons/image2.gif) | megalit porozmawiajmy o....jpg | 2022-12-01 21:09 | 698K | |
![[IMG]](/icons/image2.gif) | megalit.jpg [Automatycznie zapisany] — kopia.jpg | 2022-12-02 13:01 | 699K | |
![[IMG]](/icons/image2.gif) | Od Morowego powietrza.jpg | 2022-12-08 17:55 | 71K | |
![[IMG]](/icons/image2.gif) | Od morowego powietrza plakat.jpg | 2022-12-08 19:03 | 63K | |
![[ ]](/icons/layout.gif) | мегаліти_укр (1).pdf | 2022-12-14 08:23 | 637K | |
![[ ]](/icons/layout.gif) | бенкет_укр (1).pdf | 2022-12-14 08:23 | 872K | |
![[IMG]](/icons/image2.gif) | Minutoli_Posen_Palast_Gorka (1).jpg | 2022-12-15 10:06 | 64K | |
![[IMG]](/icons/image2.gif) | Art in Architecture.jpg | 2022-12-19 13:44 | 102K | |
![[IMG]](/icons/image2.gif) | Art in Architecture_Wyróznienie (1).jpg | 2022-12-19 13:45 | 3.4M | |
![[ ]](/icons/layout.gif) | Feast at the threshold of eternity.pdf | 2022-12-21 12:27 | 286K | |
![[ ]](/icons/layout.gif) | Feast at the threshold of eternity(1).pdf | 2022-12-21 12:27 | 286K | |
![[IMG]](/icons/image2.gif) | 2010-HB1-T10-prace16.jpg | 2022-12-22 08:44 | 1.3M | |
![[IMG]](/icons/image2.gif) | Boże Narodzenie 2022.jpg | 2022-12-22 14:25 | 3.3M | |
![[IMG]](/icons/image2.gif) | Zyczenia.jpg | 2022-12-22 14:27 | 233K | |
![[IMG]](/icons/image2.gif) | Boże Narodzenie 2022(1).jpg | 2022-12-22 14:28 | 3.3M | |
![[IMG]](/icons/image2.gif) | Obraz1(12).jpg | 2022-12-22 14:33 | 85K | |
![[IMG]](/icons/image2.gif) | Screenshot_1.jpg | 2022-12-28 11:08 | 194K | |
![[IMG]](/icons/image2.gif) | Fot. 1 Fragment diademu (fot. J. Jaskulak).JPG | 2023-01-05 15:55 | 1.0M | |
![[IMG]](/icons/image2.gif) | Logo_-czarny_-Instytucja-Kultury.jpg | 2023-01-06 09:21 | 666K | |
![[IMG]](/icons/image2.gif) | Ferie Zimowe 2023.png | 2023-01-09 09:42 | 1.4M | |
![[IMG]](/icons/image2.gif) | 319635423_2775666612567972_6548517421946167496_n.jpg | 2023-01-18 13:50 | 105K | |
![[ ]](/icons/unknown.gif) | 1408x594.jfif | 2023-01-19 06:51 | 84K | |
![[ ]](/icons/layout.gif) | Ląd - Plagi i medycyna całość (zmniejszony).pdf | 2023-01-19 09:19 | 3.1M | |
![[IMG]](/icons/image2.gif) | plagi.jpg | 2023-01-19 09:23 | 60K | |
![[IMG]](/icons/image2.gif) | Kafelek.jpg | 2023-01-26 05:44 | 15M | |
![[IMG]](/icons/image2.gif) | Finisaż Uczta i Megality.jpg | 2023-01-27 15:00 | 217K | |
![[IMG]](/icons/image2.gif) | Wypelnienie.jpg | 2023-02-11 05:32 | 16K | |
![[IMG]](/icons/image2.gif) | Stopka Wojewodztwo.jpg | 2023-02-11 05:44 | 16K | |
![[IMG]](/icons/image2.gif) | Wypel 2.jpg | 2023-02-11 05:50 | 92K | |
![[IMG]](/icons/image2.gif) | wypel 3.jpg | 2023-02-11 05:56 | 119K | |
![[IMG]](/icons/image2.gif) | bip-400x151.png | 2023-02-11 06:12 | 33K | |
![[IMG]](/icons/image2.gif) | Facebook link stopka.jpg | 2023-02-11 06:21 | 8.7K | |
![[IMG]](/icons/image2.gif) | Nekrolog_IMG_699.jpg | 2023-02-14 21:55 | 1.2M | |
![[IMG]](/icons/image2.gif) | Zofia SUlgostowska.jpg | 2023-02-14 21:57 | 73K | |
![[IMG]](/icons/image2.gif) | Wykład.jpg | 2023-02-15 08:06 | 207K | |
![[IMG]](/icons/image2.gif) | Slajd1.JPG | 2023-02-15 08:08 | 344K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_żony_stona www.png | 2023-02-24 10:57 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1080x1920_MO_Przyplyw_V22 (1).jpg | 2023-03-02 10:09 | 847K | |
![[IMG]](/icons/image2.gif) | Nieopowiedziane historie lalek.jpg | 2023-03-02 15:08 | 178K | |
![[IMG]](/icons/image2.gif) | Fot. 2 Jedna z klisz szklanych ze zbioru zdjęć archeologicznych z dwudziestolecia międzywojennego- fot. Patrycja Silska (1).JPG | 2023-03-02 22:10 | 1.1M | |
![[IMG]](/icons/image2.gif) | iugfiufigfigog.jpg | 2023-03-08 13:55 | 57K | |
![[IMG]](/icons/image2.gif) | 334679977_517553310572164_288903190010181247_n.jpg | 2023-03-16 15:14 | 144K | |
![[IMG]](/icons/image2.gif) | Pamięć zaklęta w ziemii - Wykład Marcina Ławniczaka (MAP).jpg | 2023-03-21 14:59 | 214K | |
![[IMG]](/icons/image2.gif) | Mozart.jpg | 2023-03-22 12:00 | 86K | |
![[IMG]](/icons/image2.gif) | Żegnaj, Amadeuszu! - plakat A4 do spektaklu.png | 2023-03-22 12:31 | 5.3M | |
![[IMG]](/icons/image2.gif) | Wykład o metalurgii.jpg | 2023-03-30 22:33 | 62K | |
![[IMG]](/icons/image2.gif) | zyCZenia.gif | 2023-04-05 13:22 | 177K | |
![[IMG]](/icons/image2.gif) | P1940156.jpg | 2023-04-11 13:36 | 14M | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_Agata Christie_www.jpg | 2023-04-14 12:15 | 247K | |
![[IMG]](/icons/image2.gif) | LPNEA .jpg | 2023-04-14 14:50 | 260K | |
![[IMG]](/icons/image2.gif) | strona www.jpg | 2023-04-14 20:44 | 2.0M | |
![[IMG]](/icons/image2.gif) | Spacery archeo_strona www_Genius Loci.jpg | 2023-04-21 11:34 | 647K | |
![[IMG]](/icons/image2.gif) | Noc Muzeów_www.jpg | 2023-05-09 07:54 | 525K | |
![[IMG]](/icons/image2.gif) | NM23_kwadrat.jpg | 2023-05-10 07:09 | 812K | |
![[IMG]](/icons/image2.gif) | NM23_HD-poziom.jpg | 2023-05-10 07:10 | 776K | |
![[IMG]](/icons/image2.gif) | NM 2023.jpg | 2023-05-10 07:12 | 184K | |
![[IMG]](/icons/image2.gif) | NM23.jpg | 2023-05-10 07:15 | 140K | |
![[IMG]](/icons/image2.gif) | Noc Rezerwat Harmonogram.jpg | 2023-05-10 07:42 | 88K | |
![[IMG]](/icons/image2.gif) | Ląd Tło WWW.jpg | 2023-05-18 15:05 | 622K | |
![[IMG]](/icons/image2.gif) | tŁO www lĄD 23.jpg | 2023-05-19 04:55 | 1.8M | |
![[IMG]](/icons/image2.gif) | Ląd Tło WWW(1).jpg | 2023-05-19 04:57 | 1.9M | |
![[IMG]](/icons/image2.gif) | Legendy i żródła - Ląd 2023 plakat.jpg | 2023-05-19 05:26 | 591K | |
![[IMG]](/icons/image2.gif) | NM23 Konkurs foto.jpg | 2023-05-20 16:55 | 134K | |
![[IMG]](/icons/image2.gif) | 348463889_981894923166503_9209592909219871353_n.jpg | 2023-05-24 13:41 | 2.1M | |
![[IMG]](/icons/image2.gif) | image001.png | 2023-05-25 05:53 | 3.0K | |
![[IMG]](/icons/image2.gif) | sh_logo_black_rgb.png | 2023-05-25 06:29 | 57K | |
![[IMG]](/icons/image2.gif) | sh_logo_rgb.png | 2023-05-25 06:29 | 76K | |
![[IMG]](/icons/image2.gif) | Punkt edu_wydarzenie FB i www (2).jpg | 2023-05-25 06:51 | 9.8M | |
![[IMG]](/icons/image2.gif) | Wykład Matczak.jpg | 2023-05-25 08:39 | 1.0M | |
![[IMG]](/icons/image2.gif) | KOnferencja sprawozdawcza 2023.jpg | 2023-05-28 20:58 | 329K | |
![[ ]](/icons/layout.gif) | XXII KS zgloszenie sluchacza.pdf | 2023-05-28 21:37 | 176K | |
![[ ]](/icons/layout.gif) | XXII KS program.pdf | 2023-05-30 11:21 | 590K | |
![[ ]](/icons/layout.gif) | XXII KS pismo przewodnie.pdf | 2023-05-30 11:21 | 153K | |
![[IMG]](/icons/image2.gif) | miniaturka-EDA-polecane-wydarzenia-NID-1280x857.png | 2023-06-06 07:12 | 883K | |
![[IMG]](/icons/image2.gif) | EDA 2023.jpg | 2023-06-06 07:13 | 111K | |
![[IMG]](/icons/image2.gif) | 60latmisjinid_logo_100_e6d3d0fd-e540-43cd-8940-846de9010225.jpg | 2023-06-06 07:22 | 25K | |
![[IMG]](/icons/image2.gif) | LAM 2023.jpg | 2023-06-08 11:33 | 376K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_cysterski szlak_www.jpg | 2023-06-08 11:54 | 503K | |
![[IMG]](/icons/image2.gif) | Dębska-Luty.jpg | 2023-06-26 10:46 | 422K | |
![[IMG]](/icons/image2.gif) | 1920x1080.jpg | 2023-06-28 13:44 | 661K | |
![[ ]](/icons/layout.gif) | Poznań African Conference Program-27-06-2023.pdf | 2023-06-28 13:50 | 107K | |
![[ ]](/icons/layout.gif) | Poznań African Conference Program (30.06.23).pdf | 2023-06-30 11:33 | 107K | |
![[IMG]](/icons/image2.gif) | 4707534812047201730.jpeg | 2023-07-07 11:02 | 27K | |
![[IMG]](/icons/image2.gif) | IMG_0571.jpg | 2023-07-18 13:19 | 1.4M | |
![[IMG]](/icons/image2.gif) | Fot. 2 Krzemień z wystawy - Archiwum Zdjęć MAP.jpg | 2023-07-29 20:24 | 118K | |
![[ ]](/icons/layout.gif) | Abstrakty gotowe (1)02.08.23.pdf | 2023-08-02 09:18 | 738K | |
![[IMG]](/icons/image2.gif) | EDD__strona www.jpg | 2023-08-10 14:17 | 676K | |
![[IMG]](/icons/image2.gif) | Fot 3 Ostrza krzemienne, Archiwum Zdjęć MAP.jpg | 2023-08-12 13:29 | 1.5M | |
![[IMG]](/icons/image2.gif) | Ostrza Krzemienne.jpg | 2023-08-12 13:30 | 180K | |
![[IMG]](/icons/image2.gif) | Weekend z kulturą_strona www.jpg | 2023-08-31 11:15 | 680K | |
![[IMG]](/icons/image2.gif) | ryc. 110 SL552074.jpg | 2023-09-11 11:22 | 2.6M | |
![[IMG]](/icons/image2.gif) | Bagna_warsztaty_Wydarzenie FB.jpg | 2023-09-11 12:04 | 2.0M | |
![[IMG]](/icons/image2.gif) | finisaż wystawy_strona www.jpg | 2023-09-11 12:08 | 1.8M | |
![[IMG]](/icons/image2.gif) | SENIORALNI 2023 facebook cover photo.jpg | 2023-09-21 14:12 | 586K | |
![[IMG]](/icons/image2.gif) | Senioralni iko.jpg | 2023-09-21 14:45 | 129K | |
![[IMG]](/icons/image2.gif) | Prezentacja1(4).jpg | 2023-10-09 14:38 | 77K | |
![[IMG]](/icons/image2.gif) | Ikona wpisu wirynka.jpg | 2023-10-13 08:56 | 595K | |
![[IMG]](/icons/image2.gif) | Dąbrówka.jpg | 2023-10-13 08:57 | 377K | |
![[IMG]](/icons/image2.gif) | Katharsis ik wpis.jpg | 2023-10-17 04:52 | 404K | |
![[IMG]](/icons/image2.gif) | 356888956_816676696729912_1055816715704236669_n.jpg | 2023-10-17 05:59 | 574K | |
![[IMG]](/icons/image2.gif) | Erasmus +.jpg | 2023-10-17 07:22 | 335K | |
![[IMG]](/icons/image2.gif) | Erasmus + Eng.jpg | 2023-10-17 07:26 | 272K | |
![[IMG]](/icons/image2.gif) | plakat_Dabrowka.jpg | 2023-10-17 12:49 | 1.2M | |
![[IMG]](/icons/image2.gif) | plakat_Dabrowka (1).jpg | 2023-10-17 12:50 | 1.2M | |
![[IMG]](/icons/image2.gif) | PL Dofinansowane przez UE_POS.png | 2023-10-18 07:35 | 33K | |
![[IMG]](/icons/image2.gif) | EN_FundedbytheEU_RGB_POS.png | 2023-10-18 07:47 | 61K | |
![[IMG]](/icons/image2.gif) | Edukujmy.JPG | 2023-10-23 12:43 | 8.3M | |
![[IMG]](/icons/image2.gif) | plakat_Dabrowka(1).jpg | 2023-10-24 06:08 | 1.2M | |
![[IMG]](/icons/image2.gif) | Dąbrówka iko wpis.jpg | 2023-10-24 06:13 | 156K | |
![[IMG]](/icons/image2.gif) | Fragment kamienia erekcyjnego pod kościół w Bninie z herbem Łodzia fot. Ł. Bartkowiak.jpg | 2023-10-30 06:20 | 2.9M | |
![[IMG]](/icons/image2.gif) | 20231030_100720.jpg | 2023-11-01 08:13 | 2.9M | |
![[IMG]](/icons/image2.gif) | 20231030_100728.jpg | 2023-11-01 08:13 | 2.9M | |
![[IMG]](/icons/image2.gif) | 20231030_100736.jpg | 2023-11-01 08:13 | 2.5M | |
![[IMG]](/icons/image2.gif) | 20231030_100749.jpg | 2023-11-01 08:13 | 3.0M | |
![[IMG]](/icons/image2.gif) | 20231030_100759.jpg | 2023-11-01 08:14 | 2.9M | |
![[IMG]](/icons/image2.gif) | 20231030_100807.jpg | 2023-11-01 08:14 | 3.9M | |
![[IMG]](/icons/image2.gif) | 20231030_100852.jpg | 2023-11-01 08:14 | 3.5M | |
![[IMG]](/icons/image2.gif) | 20231030_100900.jpg | 2023-11-01 08:14 | 2.7M | |
![[IMG]](/icons/image2.gif) | jesień2023.jpg | 2023-11-02 10:35 | 452K | |
![[IMG]](/icons/image2.gif) | Fot.3 Wystawa zwiedzana w trakcie Festiwalu w Lądzie nad Wartą - fot. B. Walkiewicz.jpg | 2023-11-11 10:58 | 851K | |
![[IMG]](/icons/image2.gif) | Fot. 2 Zabytki w trakcie konserawcji - fot. P. Majorek (2).JPG | 2023-11-11 12:32 | 12M | |
![[IMG]](/icons/image2.gif) | 05_znak_uproszczony_kolor_biale_tlo_CMYK-01.jpg | 2023-11-11 13:59 | 880K | |
![[IMG]](/icons/image2.gif) | logo_herb_poziom_sww_kolor.jpg | 2023-11-11 14:00 | 194K | |
![[IMG]](/icons/image2.gif) | Fot. 4 Arthur Conan Doyle, fot. Herbert Rose Barraud, 1893 (domena publiczna) (1).jpg | 2023-11-11 14:56 | 95K | |
![[IMG]](/icons/image2.gif) | Doyle.jpg | 2023-11-11 14:58 | 129K | |
![[IMG]](/icons/image2.gif) | ANdrzej Sikorski.jpg | 2023-11-11 23:16 | 140K | |
![[IMG]](/icons/image2.gif) | ANdrzej Sikorski(1).jpg | 2023-11-11 23:17 | 140K | |
![[IMG]](/icons/image2.gif) | Post na fb.png | 2023-11-20 07:50 | 804K | |
![[IMG]](/icons/image2.gif) | Dyrektorzy.jpg | 2023-11-20 13:33 | 148K | |
![[IMG]](/icons/image2.gif) | IMG_20231103_141922.jpg | 2023-11-20 13:37 | 4.5M | |
![[IMG]](/icons/image2.gif) | IMG_20231103_141850.jpg | 2023-11-20 13:38 | 3.8M | |
![[IMG]](/icons/image2.gif) | 368449022_772277601289158_6628428391874662003_n.jpg | 2023-11-20 13:41 | 115K | |
![[IMG]](/icons/image2.gif) | B.CLarys.jpg | 2023-11-22 06:20 | 290K | |
![[IMG]](/icons/image2.gif) | KOncert Barokowy.jpg | 2023-11-22 06:24 | 138K | |
![[IMG]](/icons/image2.gif) | 402246355_1235419554076240_4668914264150138385_n.jpg | 2023-11-22 06:26 | 130K | |
![[IMG]](/icons/image2.gif) | Liofilizator Tło.jpg | 2023-11-27 09:48 | 62K | |
![[IMG]](/icons/image2.gif) | Mikołajki_www.jpg | 2023-11-28 12:31 | 1.0M | |
![[IMG]](/icons/image2.gif) | Fot.3 Głowa człowieka z bagien Tollund. Znaleziona 1950-05-06 w pobliżu Tollund, Silkebjorg, Dania i datowana C14 na około 375-210 pne. Autor Sven Rosborn (domena publiczna)..jpg | 2023-12-10 20:22 | 97K | |
![[IMG]](/icons/image2.gif) | Kostzrewski tło www.jpg | 2023-12-15 15:44 | 53K | |
![[IMG]](/icons/image2.gif) | Życzenia MAP tło.jpg | 2023-12-21 13:57 | 1.9M | |
![[IMG]](/icons/image2.gif) | Życzenia MAP tekst.jpg | 2023-12-21 13:58 | 1.4M | |
![[IMG]](/icons/image2.gif) | 411221275_701231082113723_1083815029179639767_n.jpg | 2024-01-02 13:30 | 170K | |
![[IMG]](/icons/image2.gif) | plakat_MAP.jpg | 2024-01-02 14:12 | 1.1M | |
![[IMG]](/icons/image2.gif) | Żywot Długi infografika.jpg | 2024-01-11 13:40 | 1.3M | |
![[ ]](/icons/layout.gif) | Prezentacja Publikacja o Józefie Kostrzewskim.pdf | 2024-01-11 13:43 | 2.3M | |
![[IMG]](/icons/image2.gif) | IMG_20240119_194628.jpg | 2024-01-22 12:49 | 249K | |
![[IMG]](/icons/image2.gif) | Iko wpisu wykład.jpg | 2024-01-24 11:43 | 167K | |
![[IMG]](/icons/image2.gif) | tablica__zbiorcza_fundusz_60x40 - liofilizator.jpg | 2024-01-26 12:05 | 259K | |
![[ ]](/icons/layout.gif) | Muzeum Archeologiczne_Oferta pracy.pdf | 2024-01-26 13:06 | 184K | |
![[IMG]](/icons/image2.gif) | ferie_www.jpg | 2024-01-29 07:17 | 1.1M | |
![[IMG]](/icons/image2.gif) | Strona internetowa (1).png | 2024-02-07 09:27 | 351K | |
![[IMG]](/icons/image2.gif) | Belka Logotypów Marszałkowskich.jpg | 2024-02-07 10:00 | 11K | |
![[IMG]](/icons/image2.gif) | Belka Marszałek.jpg | 2024-02-07 10:23 | 33K | |
![[ ]](/icons/layout.gif) | Ląd 2023 - Legendy i źródła (WEB) - z zakładkami (1).pdf | 2024-02-13 13:47 | 5.1M | |
![[IMG]](/icons/image2.gif) | Ląd Tło Publikacja.jpg | 2024-02-13 13:48 | 75K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_badania na rynku_www.jpg | 2024-02-22 10:28 | 705K | |
![[IMG]](/icons/image2.gif) | wykład 28 lutego.jpg | 2024-02-22 20:38 | 945K | |
![[ ]](/icons/layout.gif) | Regulamin lekcji muzealnych - aktualizacja.pdf | 2024-02-27 13:18 | 217K | |
![[IMG]](/icons/image2.gif) | Fot 3.Zestawienie szachów współczesnych i średniowiecznych - fot. T. Skorupka (1).jpg | 2024-02-28 10:12 | 4.5M | |
![[IMG]](/icons/image2.gif) | Stroje z epoki - ArchMAGfot. M. Jasiński.JPG | 2024-02-29 10:54 | 23M | |
![[IMG]](/icons/image2.gif) | Strój_FB-INSTA.jpg | 2024-02-29 12:53 | 3.2M | |
![[IMG]](/icons/image2.gif) | Tabulae_www.jpg | 2024-03-06 09:40 | 2.0M | |
![[IMG]](/icons/image2.gif) | Obraz1(13).jpg | 2024-03-06 09:42 | 120K | |
![[IMG]](/icons/image2.gif) | Tabulae_wydarzenie-wykład.jpg | 2024-03-06 09:51 | 3.0M | |
![[IMG]](/icons/image2.gif) | Prezentacja1(5).jpg | 2024-03-06 09:55 | 112K | |
![[IMG]](/icons/image2.gif) | Odyseja str.jpg | 2024-03-09 06:54 | 478K | |
![[ ]](/icons/layout.gif) | Kabaciński_J_2023_Treasures from the bog-Krzyż Wielkopolski.pdf | 2024-03-15 06:48 | 18M | |
![[IMG]](/icons/image2.gif) | wykład 20 marca.jpg | 2024-03-18 13:18 | 4.4M | |
![[IMG]](/icons/image2.gif) | Fot 5 Brązowe szpile. Fot. Michał Święcicki.jpg | 2024-03-18 13:24 | 3.9M | |
![[IMG]](/icons/image2.gif) | Fot 5 Brązowe szpile. Fot. Michał Święcicki(1).jpg | 2024-03-18 13:25 | 3.9M | |
![[IMG]](/icons/image2.gif) | życzenia na stronę.jpg | 2024-03-27 13:41 | 383K | |
![[IMG]](/icons/image2.gif) | życzenia na stronę 2.jpg | 2024-03-27 13:42 | 467K | |
![[IMG]](/icons/image2.gif) | Fot.3 Ostrza Krzemienne – Archiwum Zdjęć MAP.jpg | 2024-04-02 10:30 | 1.5M | |
![[IMG]](/icons/image2.gif) | Porozmiawiajmy o_krzemienie_www.jpg | 2024-04-11 13:05 | 599K | |
![[IMG]](/icons/image2.gif) | Obraz1(14).jpg | 2024-04-16 11:36 | 49K | |
![[IMG]](/icons/image2.gif) | Prezentacja1(6).jpg | 2024-04-16 11:43 | 232K | |
![[IMG]](/icons/image2.gif) | logo_XXIII_KS.jpg | 2024-04-19 09:40 | 234K | |
![[ ]](/icons/layout.gif) | XXIII konferencja sprawozdawcza - zgłoszenie referenta.pdf | 2024-04-19 09:43 | 188K | |
![[ ]](/icons/layout.gif) | XXIII konferencja sprawozdawcza - zgoda na przetwarzanie danych osobowych.pdf | 2024-04-19 09:43 | 193K | |
![[IMG]](/icons/image2.gif) | Noc Muzeów 2024.jpg | 2024-04-24 11:42 | 120K | |
![[ ]](/icons/layout.gif) | Kostrzewski na stronę internetową MAP - z okładkami i zakładkami rozszerzonymi (poprawiony 23 kwietnia 2024).pdf | 2024-04-30 11:32 | 15M | |
![[IMG]](/icons/image2.gif) | 439221341_903654494894531_3722119278476547188_n.jpg | 2024-05-02 14:54 | 1.0M | |
![[IMG]](/icons/image2.gif) | berlin-1079616_1280 (1).jpg | 2024-05-07 13:03 | 197K | |
![[IMG]](/icons/image2.gif) | Berlin_Neues_Museum_001.JPG | 2024-05-07 13:05 | 418K | |
![[IMG]](/icons/image2.gif) | berlin-1079616_1280 (1)(1).jpg | 2024-05-07 13:05 | 197K | |
![[IMG]](/icons/image2.gif) | Fot. 7 Sztylet z Hindsgavldolken, wykonany ze spłaszczonego krzemienia z rękojeścią w kształcie rybiego ogona. Fpt. commons.wikimedia.org (1).jpg | 2024-05-07 13:44 | 476K | |
![[IMG]](/icons/image2.gif) | Troja_str. www.jpg | 2024-05-07 14:21 | 531K | |
![[IMG]](/icons/image2.gif) | berlin-1079616_1280 (1)(2).jpg | 2024-05-07 14:32 | 197K | |
![[IMG]](/icons/image2.gif) | Berlin_Neues_Museum_001(1).JPG | 2024-05-07 14:32 | 418K | |
![[IMG]](/icons/image2.gif) | Berlin_Neues_Museum_001(2).JPG | 2024-05-07 14:33 | 418K | |
![[IMG]](/icons/image2.gif) | Berenike.jpg | 2024-05-14 17:38 | 213K | |
![[IMG]](/icons/image2.gif) | 438078199_849004683938581_652635615002016462_n.jpg | 2024-05-22 11:46 | 159K | |
![[IMG]](/icons/image2.gif) | 441958866_968833908579338_3563774126387284128_n.jpg | 2024-05-22 20:22 | 67K | |
![[IMG]](/icons/image2.gif) | 445077377_968653121930750_2871825634499535291_n.jpg | 2024-05-22 20:22 | 111K | |
![[IMG]](/icons/image2.gif) | Sybilla.jpg | 2024-05-22 20:23 | 179K | |
![[IMG]](/icons/image2.gif) | Christie.jpg | 2024-05-23 13:31 | 215K | |
![[IMG]](/icons/image2.gif) | Belka christie.jpg | 2024-05-24 08:44 | 87K | |
![[IMG]](/icons/image2.gif) | 442411063_1030593212004925_4973813782031212067_n.jpg | 2024-05-27 09:43 | 68K | |
![[ ]](/icons/layout.gif) | Program XXIII KS (1).pdf | 2024-05-29 09:28 | 425K | |
![[IMG]](/icons/image2.gif) | logo_XXIII_KS(1).jpg | 2024-05-29 09:34 | 234K | |
![[IMG]](/icons/image2.gif) | na kafelek (1).jpg | 2024-05-29 14:52 | 240K | |
![[ ]](/icons/layout.gif) | Odyseja kultur_owa-harmonogram-nowy (1).pdf | 2024-05-29 14:53 | 1.3M | |
![[ ]](/icons/layout.gif) | wykaz zdjęć .pdf | 2024-06-03 10:25 | 363K | |
![[IMG]](/icons/image2.gif) | EDA_2024_str.jpg | 2024-06-04 10:09 | 718K | |
![[IMG]](/icons/image2.gif) | 60 lat misji NID_logo_250px.png | 2024-06-04 11:40 | 10K | |
![[IMG]](/icons/image2.gif) | 60 lat misji NID_logo_1.jpg | 2024-06-04 11:41 | 84K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_Moda męska_www.jpg | 2024-06-05 10:40 | 721K | |
![[ ]](/icons/layout.gif) | MAP-3040-13-24 WYNIK.pdf | 2024-06-10 22:33 | 818K | |
![[ ]](/icons/layout.gif) | CCE20240610 (1).pdf | 2024-06-10 22:36 | 476K | |
![[IMG]](/icons/image2.gif) | przegladksiązki.jpg | 2024-06-14 08:38 | 135K | |
![[ ]](/icons/layout.gif) | map regulamin.pdf | 2024-06-14 16:00 | 1.7M | |
![[ ]](/icons/layout.gif) | map umowa sprzedazy auta.pdf | 2024-06-14 16:00 | 601K | |
![[ ]](/icons/layout.gif) | map ogoszenie o przetargu.pdf | 2024-06-14 16:00 | 438K | |
![[ ]](/icons/layout.gif) | map oferta na zakup.pdf | 2024-06-14 16:00 | 477K | |
![[IMG]](/icons/image2.gif) | LAM24_www.jpg | 2024-06-17 09:51 | 787K | |
![[IMG]](/icons/image2.gif) | finisaż Egipt_strona www.jpg | 2024-06-17 18:13 | 905K | |
![[IMG]](/icons/image2.gif) | Ushepti_strona www.jpg | 2024-06-18 10:27 | 956K | |
![[ ]](/icons/layout.gif) | Renault Traffic - wynik.pdf | 2024-06-25 14:25 | 582K | |
![[IMG]](/icons/image2.gif) | na stronę (1).jpg | 2024-06-28 13:39 | 949K | |
![[IMG]](/icons/image2.gif) | plakat__fundusz__celowy__420x297 - Chrobry(dobry).jpg | 2024-06-28 16:09 | 154K | |
![[IMG]](/icons/image2.gif) | plakat__fundusz__celowy__420x297 - katalog dobry).jpg | 2024-06-28 16:11 | 170K | |
![[IMG]](/icons/image2.gif) | unnamed (1).jpg | 2024-07-02 08:02 | 7.9K | |
![[IMG]](/icons/image2.gif) | strona.jpg | 2024-07-04 12:04 | 230K | |
![[IMG]](/icons/image2.gif) | E.Pudełko.jpg | 2024-07-09 12:55 | 111K | |
![[IMG]](/icons/image2.gif) | E.Pudełko(1).jpg | 2024-07-09 12:56 | 111K | |
![[IMG]](/icons/image2.gif) | IMG_20240705_092348.jpg | 2024-07-09 14:03 | 89K | |
![[IMG]](/icons/image2.gif) | Publikacja Szachy.jpg | 2024-07-16 16:46 | 65K | |
![[ ]](/icons/layout.gif) | Szachy promocja_filmik.pdf | 2024-07-16 17:14 | 4.4M | |
![[IMG]](/icons/image2.gif) | plakat_fundusz_celowy_420x297-100.jpg | 2024-07-24 14:09 | 1.1M | |
![[ ]](/icons/layout.gif) | Zapytanie z dn.05.07.2024r(e).pdf | 2024-07-28 11:21 | 61K | |
![[ ]](/icons/layout.gif) | WYNIK zapytanie ofertowe 2232-01-24.pdf | 2024-08-02 01:32 | 448K | |
![[ ]](/icons/layout.gif) | Ponowne złożenie ofert z uwzględnieniem wprowadzonych zmian.pdf | 2024-08-12 14:13 | 51K | |
![[ ]](/icons/layout.gif) | Specyfikacja (1).pdf | 2024-08-12 14:14 | 194K | |
![[ ]](/icons/unknown.gif) | MAP- standardy ochrony małoletnich_2024-07-03 ZUPEŁNA (1).docx | 2024-08-14 06:33 | 38K | |
![[ ]](/icons/unknown.gif) | MAP- wersja skrócona standardy ochrony małoletnich_2024-07-03 (002) SKROCONA.docx | 2024-08-14 06:33 | 26K | |
![[ ]](/icons/unknown.gif) | MAP- standardy ochrony małoletnich_2024-07-03 ZUPEŁNA (1)(1).docx | 2024-08-14 06:34 | 38K | |
![[ ]](/icons/layout.gif) | MAP- wersja skrócona standardy ochrony małoletnich_2024-07-03 (002) SKROCONA.pdf | 2024-08-14 06:42 | 128K | |
![[ ]](/icons/layout.gif) | MAP- standardy ochrony małoletnich_2024-07-03 ZUPEŁNA (1).pdf | 2024-08-14 06:42 | 155K | |
![[ ]](/icons/layout.gif) | Zapytanie 2232-01-24 WYNIK II.pdf | 2024-08-19 17:29 | 463K | |
![[IMG]](/icons/image2.gif) | 20240820_100817.jpg | 2024-08-20 11:20 | 3.5M | |
![[IMG]](/icons/image2.gif) | 456113693_1045525804028349_5341377331586788309_n.jpg | 2024-08-28 11:40 | 52K | |
![[IMG]](/icons/image2.gif) | edd_banner_1920x1080_2024_03_1920x1080-c-1300x732.jpg | 2024-08-28 16:13 | 137K | |
![[IMG]](/icons/image2.gif) | 456113693_1045525804028349_5341377331586788309_n (1).jpg | 2024-08-28 16:15 | 53K | |
![[IMG]](/icons/image2.gif) | EDD_banner_1920x1080-c.jpg | 2024-08-29 12:19 | 838K | |
![[IMG]](/icons/image2.gif) | Niestępowo.jpg | 2024-08-29 17:51 | 3.9M | |
![[IMG]](/icons/image2.gif) | weekend-seniora-slider-1.png | 2024-09-04 08:19 | 151K | |
![[IMG]](/icons/image2.gif) | Fot. 1 Krzemienie, Krzyż Wlkp., (fot. M. Jórdeczka).jpg | 2024-09-04 08:20 | 176K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_Moda damska_www.jpg | 2024-09-06 14:25 | 660K | |
![[IMG]](/icons/image2.gif) | plakat_fundusz_celowy_420x297-100(1).jpg | 2024-09-13 11:03 | 1.1M | |
![[IMG]](/icons/image2.gif) | Chaławy- wykopaliska.jpg | 2024-09-13 11:14 | 103K | |
![[IMG]](/icons/image2.gif) | Jest impreza.jpg | 2024-09-13 14:51 | 114K | |
![[IMG]](/icons/image2.gif) | 1000012638.jpg | 2024-09-13 14:53 | 306K | |
![[IMG]](/icons/image2.gif) | 1000012639.jpg | 2024-09-13 14:53 | 445K | |
![[IMG]](/icons/image2.gif) | 1000012640.jpg | 2024-09-13 14:53 | 580K | |
![[IMG]](/icons/image2.gif) | Fot. 1 Krzemienie, Krzyż Wlkp., (fot. M. Jórdeczka) (1).jpg | 2024-09-18 11:23 | 176K | |
![[IMG]](/icons/image2.gif) | Weekend seniora z kulturą tło.jpg | 2024-09-18 11:25 | 153K | |
![[ ]](/icons/layout.gif) | MAP-procedura sygnalistów-skrócona.pdf | 2024-09-27 12:42 | 417K | |
![[IMG]](/icons/image2.gif) | Fot. 2 Kalendarz kieszonkowy z przedstawieniem prac miesięcy - IX-XII - ca. 1400 r. (domena publiczna) (2).jpg | 2024-10-09 13:50 | 414K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_Czas i znaki zodiaku_www.png | 2024-10-09 13:51 | 1.9M | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o....jpg | 2024-10-09 14:14 | 700K | |
![[IMG]](/icons/image2.gif) | Prezentacja promocja.tif | 2024-10-17 12:55 | 513K | |
![[IMG]](/icons/image2.gif) | Obraz1(15).jpg | 2024-10-17 12:57 | 151K | |
![[IMG]](/icons/image2.gif) | Fot. 3 Obraz Tadeusza Badowskiego.jpg | 2024-10-18 11:07 | 196K | |
![[IMG]](/icons/image2.gif) | Zaproszenie.jpg | 2024-10-18 11:12 | 573K | |
![[IMG]](/icons/image2.gif) | Senioralni_str. www.jpg | 2024-10-18 11:58 | 1.3M | |
![[IMG]](/icons/image2.gif) | Prof. Michał Kobusiewicz.jpg | 2024-10-21 14:15 | 52K | |
![[IMG]](/icons/image2.gif) | Weekend z przodkami_str. www.jpg | 2024-10-25 12:36 | 754K | |
![[IMG]](/icons/image2.gif) | Spacer_strona www(1).jpg | 2024-10-30 13:14 | 1.6M | |
![[IMG]](/icons/image2.gif) | Plakat Kieler Tage.jpg | 2024-11-13 11:13 | 105K | |
![[IMG]](/icons/image2.gif) | Plakat Kieler Tage 2.jpg | 2024-11-13 11:17 | 159K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_urny twarzowe_www.jpg | 2024-11-13 15:21 | 752K | |
![[IMG]](/icons/image2.gif) | Archeo_1920x1080_2.jpg | 2024-11-22 12:27 | 1.3M | |
![[ ]](/icons/layout.gif) | Archeo_plakat_2.pdf | 2024-11-22 12:28 | 9.8M | |
![[IMG]](/icons/image2.gif) | Plakat Tam gdzie.jpg | 2024-11-22 12:30 | 109K | |
![[IMG]](/icons/image2.gif) | Saturnalia_str. www.jpg | 2024-11-22 14:23 | 499K | |
![[IMG]](/icons/image2.gif) | 467906455_1151612443472245_5062462379912756486_n.jpg | 2024-11-26 13:24 | 472K | |
![[IMG]](/icons/image2.gif) | Obraz3(4).jpg | 2024-12-02 16:01 | 49K | |
![[IMG]](/icons/image2.gif) | Obraz4(3).jpg | 2024-12-02 16:03 | 298K | |
![[IMG]](/icons/image2.gif) | plak.jpeg | 2024-12-02 16:04 | 3.6M | |
![[IMG]](/icons/image2.gif) | Jośka str.jpg | 2024-12-03 07:34 | 700K | |
![[IMG]](/icons/image2.gif) | ARche ARcheo Archeologia.jpg | 2024-12-03 07:53 | 261K | |
![[IMG]](/icons/image2.gif) | Obraz1(16).jpg | 2024-12-04 13:58 | 86K | |
![[IMG]](/icons/image2.gif) | Spacer do MNP_strona www.jpg | 2024-12-05 09:14 | 1.8M | |
![[IMG]](/icons/image2.gif) | Obraz2(6).jpg | 2024-12-05 12:18 | 191K | |
![[ ]](/icons/layout.gif) | Informacja_z_otwarcia_ofert.pdf | 2024-12-06 14:29 | 170K | |
![[ ]](/icons/layout.gif) | protokol - oferty co.pdf | 2024-12-06 14:46 | 127K | |
![[IMG]](/icons/image2.gif) | Obraz2(7).jpg | 2024-12-07 08:04 | 595K | |
![[IMG]](/icons/image2.gif) | Saturnalia_ODWOŁANY_wyd. FB_wyklad.jpg | 2024-12-07 11:01 | 749K | |
![[IMG]](/icons/image2.gif) | Chrześcijański amulet tekstowy.jpg | 2024-12-10 06:44 | 235K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_Bożym Narodzeniu_www.jpg | 2024-12-11 08:41 | 613K | |
![[IMG]](/icons/image2.gif) | 468613207_1173263534404558_4737098908879664512_n.jpg | 2024-12-18 12:23 | 672K | |
![[IMG]](/icons/image2.gif) | 470174216_1181266616937583_1349956048015452594_n (1).jpg | 2024-12-18 12:25 | 193K | |
![[IMG]](/icons/image2.gif) | Prezentacja1(7).jpg | 2024-12-20 12:07 | 156K | |
![[ ]](/icons/layout.gif) | Wynik www.pdf | 2024-12-30 14:00 | 227K | |
![[ ]](/icons/layout.gif) | 23122024_Protokół zotwarcia ofert na wykonanie dokumentacji pro.pdf | 2024-12-30 14:30 | 162K | |
![[IMG]](/icons/image2.gif) | Ferie_str. www.jpg | 2025-01-07 09:31 | 1.6M | |
![[ ]](/icons/layout.gif) | CCE20250107.pdf | 2025-01-08 08:23 | 34K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_praktykach kulinarnych_www.jpg | 2025-01-09 10:46 | 705K | |
![[IMG]](/icons/image2.gif) | Obraz2(8).jpg | 2025-01-09 16:22 | 409K | |
![[IMG]](/icons/image2.gif) | 473036679_1196683215395923_7433969773078364381_n.jpg | 2025-01-09 16:23 | 501K | |
![[IMG]](/icons/image2.gif) | 472858209_1196683185395926_5575017576113174167_n.jpg | 2025-01-09 16:23 | 498K | |
![[IMG]](/icons/image2.gif) | 473036679_1196683215395923_7433969773078364381_n(1).jpg | 2025-01-09 16:24 | 501K | |
![[IMG]](/icons/image2.gif) | Fot. 4 Duet Kurkowicz Braszak (1).jpg | 2025-01-13 12:12 | 572K | |
![[IMG]](/icons/image2.gif) | Edukujmy się.jpg | 2025-01-22 09:54 | 53K | |
![[IMG]](/icons/image2.gif) | Edukujmy się 02.jpg | 2025-01-22 09:58 | 103K | |
![[IMG]](/icons/image2.gif) | Edukujmy się 03.jpg | 2025-01-22 10:02 | 110K | |
![[IMG]](/icons/image2.gif) | Edukujmy się 04.jpg | 2025-01-22 10:09 | 80K | |
![[IMG]](/icons/image2.gif) | Edukujmy się 05.jpg | 2025-01-22 12:28 | 103K | |
![[IMG]](/icons/image2.gif) | Edukujmy się 06.jpg | 2025-01-22 12:28 | 108K | |
![[IMG]](/icons/image2.gif) | Edukujmy się 07.jpg | 2025-01-22 12:28 | 99K | |
![[IMG]](/icons/image2.gif) | Edukujmy się 08.jpg | 2025-01-22 12:28 | 132K | |
![[IMG]](/icons/image2.gif) | Edukujmy się 09.jpg | 2025-01-22 12:37 | 112K | |
![[IMG]](/icons/image2.gif) | logo_herb_poziom_sww_kolor(1).jpg | 2025-01-28 10:14 | 194K | |
![[IMG]](/icons/image2.gif) | Obraz2(9).jpg | 2025-01-29 12:39 | 46K | |
![[IMG]](/icons/image2.gif) | Screenshot_25.jpg | 2025-01-29 12:53 | 55K | |
![[ ]](/icons/layout.gif) | Wynik Egipt strona.pdf | 2025-01-31 13:09 | 48K | |
![[IMG]](/icons/image2.gif) | 468299452_910760814494081_6432082097114456765_n.jpg | 2025-01-31 16:43 | 56K | |
![[IMG]](/icons/image2.gif) | 475439990_953919583511537_9153253506251113510_n.jpg | 2025-01-31 16:44 | 67K | |
![[IMG]](/icons/image2.gif) | ppt4AA5.pptm [Automatycznie zapisany].jpg | 2025-01-31 16:50 | 134K | |
![[IMG]](/icons/image2.gif) | ppt4AA5.pptm [Automatycznie zapisany](1).jpg | 2025-01-31 16:51 | 134K | |
![[IMG]](/icons/image2.gif) | Wykład Ławniczak.jpg | 2025-02-06 10:48 | 135K | |
![[IMG]](/icons/image2.gif) | 475737308_1218991583165086_2227566500859266654_n.jpg | 2025-02-06 10:49 | 206K | |
![[IMG]](/icons/image2.gif) | Walentynki_www.jpg | 2025-02-07 14:10 | 1.2M | |
![[IMG]](/icons/image2.gif) | Walentynki_www(1).jpg | 2025-02-07 14:10 | 1.2M | |
![[ ]](/icons/unknown.gif) | Formularz zgłoszeniowy 2025.docx | 2025-02-10 12:14 | 17K | |
![[IMG]](/icons/image2.gif) | Na stronę-3.jpg | 2025-02-11 07:01 | 3.5M | |
![[IMG]](/icons/image2.gif) | Screenshot_1(1).jpg | 2025-02-13 11:09 | 97K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_Bab ili_www.png | 2025-02-14 10:56 | 3.0M | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_Bab ili_wydarzenie FB.png | 2025-02-14 10:56 | 2.5M | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy o_Bab ili_www.jpg | 2025-02-14 11:04 | 1.1M | |
![[IMG]](/icons/image2.gif) | Obraz1(17).jpg | 2025-02-14 11:06 | 562K | |
![[IMG]](/icons/image2.gif) | Obraz1(18).jpg | 2025-02-24 14:54 | 101K | |
![[IMG]](/icons/image2.gif) | Obraz1(19).jpg | 2025-03-04 12:56 | 83K | |
![[ ]](/icons/layout.gif) | Program_działania-2025_2030 (1).pdf | 2025-03-04 14:31 | 3.5M | |
![[IMG]](/icons/image2.gif) | Najmniejsze miasto - zaproszenie kafel.jpg | 2025-03-06 11:37 | 155K | |
![[IMG]](/icons/image2.gif) | Najmniejsze miasto - zaproszenie.jpg | 2025-03-06 11:37 | 204K | |
![[ ]](/icons/layout.gif) | BFAP 30 - Ostrówek (najmniejszy opt).pdf | 2025-03-10 10:17 | 23M | |
![[IMG]](/icons/image2.gif) | Obraz1(20).jpg | 2025-03-10 10:28 | 305K | |
![[IMG]](/icons/image2.gif) | Belka Ostrowek.jpg | 2025-03-10 13:17 | 113K | |
![[IMG]](/icons/image2.gif) | Tajemnice-dłoni_strona-www.jpg | 2025-03-12 11:03 | 62K | |
![[IMG]](/icons/image2.gif) | wykład 19 marca (1).jpg | 2025-03-13 15:14 | 900K | |
![[IMG]](/icons/image2.gif) | abstrakt (3).jpg | 2025-03-13 15:15 | 863K | |
![[IMG]](/icons/image2.gif) | Prezentacja1(8).jpg | 2025-03-17 19:01 | 191K | |
![[ ]](/icons/layout.gif) | Porgram Konferencji 2025.pdf | 2025-03-25 10:52 | 70K | |
![[ ]](/icons/layout.gif) | Porgram Konferencji 2025(1).pdf | 2025-03-25 10:53 | 70K | |
![[ ]](/icons/layout.gif) | Porgram Konferencji 2025(2).pdf | 2025-03-25 10:54 | 70K | |
![[IMG]](/icons/image2.gif) | ProgramXXIVKS.jpg | 2025-03-25 11:55 | 710K | |
![[ ]](/icons/layout.gif) | ProgramXXIVKS 8.pdf | 2025-03-26 13:09 | 4.7M | |
![[ ]](/icons/layout.gif) | ProgramXXIVKS 8(1).pdf | 2025-03-26 13:10 | 4.7M | |
![[IMG]](/icons/image2.gif) | Logo konferencji.jpg | 2025-03-26 13:22 | 1.8M | |
![[IMG]](/icons/image2.gif) | Logo konferencji(1).jpg | 2025-03-26 13:25 | 1.8M | |
![[ ]](/icons/layout.gif) | Raport o stanie zapewniania dostępności podmiotu publicznego_stan w dn. 1.01.2025.pdf | 2025-04-01 09:44 | 154K | |
![[IMG]](/icons/image2.gif) | PLAKAT na XXIV konferencję- SEZON-organizatorzy.jpg | 2025-04-02 23:12 | 14M | |
![[IMG]](/icons/image2.gif) | Wizualizacja.jpg | 2025-04-11 06:58 | 182K | |
![[IMG]](/icons/image2.gif) | Diada Ramzesa II i Amona z światyni w Karnaku - N.P. 19 dyn..jpg | 2025-04-11 06:58 | 183K | |
![[IMG]](/icons/image2.gif) | Narożnik piramidy Chafre. w tle piramida Menkaura, S.P. 4 dyn..jpg | 2025-04-11 06:58 | 219K | |
![[IMG]](/icons/image2.gif) | Obelis Thotmesa I w świątyni w KarnakuN.P. 18 dyn..jpg | 2025-04-11 06:58 | 190K | |
![[IMG]](/icons/image2.gif) | Sala hypostylowa w światyni w Karnaku N.P. 19 dyn..jpg | 2025-04-11 06:58 | 444K | |
![[IMG]](/icons/image2.gif) | Weekend z Kakao.jpg | 2025-04-16 12:53 | 43K | |
![[IMG]](/icons/image2.gif) | Plakat Kakao.png | 2025-04-16 12:55 | 154K | |
![[IMG]](/icons/image2.gif) | Weekend_Kakao_strona www.png | 2025-04-16 13:01 | 133K | |
![[IMG]](/icons/image2.gif) | Życzenia.jpg | 2025-04-17 13:31 | 160K | |
![[IMG]](/icons/image2.gif) | kartka minitura (1).png | 2025-04-17 13:32 | 2.0M | |
![[IMG]](/icons/image2.gif) | 131966592_3769963466359327_327418827686276517_n.jpg | 2025-04-18 12:06 | 814K | |
![[IMG]](/icons/image2.gif) | 2---.jpg | 2025-04-18 12:08 | 6.4M | |
![[IMG]](/icons/image2.gif) | 491004509_1277869743943936_1708516321555499036_n.jpg | 2025-04-18 12:23 | 703K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy-o..._Chrobry_strona-www.png | 2025-04-19 17:13 | 169K | |
![[IMG]](/icons/image2.gif) | Wydarzenie FB.jpg | 2025-05-08 15:49 | 504K | |
![[IMG]](/icons/image2.gif) | Noc-muzeów_strona-www.jpg | 2025-05-09 13:45 | 84K | |
![[IMG]](/icons/image2.gif) | Novae tło.jpg | 2025-05-09 15:00 | 125K | |
![[IMG]](/icons/image2.gif) | plakat_Novae wersja elektroniczna.jpg | 2025-05-09 15:03 | 3.8M | |
![[IMG]](/icons/image2.gif) | Noc-muzeów_konserwator_www.jpg | 2025-05-09 17:50 | 63K | |
![[IMG]](/icons/image2.gif) | Noc-muzeów_warsztaty_strona-www.jpg | 2025-05-09 17:54 | 81K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy-o...rytach_strona-www.jpg | 2025-05-13 09:14 | 59K | |
![[IMG]](/icons/image2.gif) | 493536287_1112081064297607_3663325768607848563_n.jpg | 2025-05-13 11:22 | 102K | |
![[IMG]](/icons/image2.gif) | Prezentacja1(9).jpg | 2025-05-13 11:26 | 215K | |
![[IMG]](/icons/image2.gif) | IMG_8516.JPG | 2025-05-21 07:40 | 7.9M | |
![[IMG]](/icons/image2.gif) | Petroglify tło.jpg | 2025-05-22 14:07 | 970K | |
![[IMG]](/icons/image2.gif) | Pacynki_strona-www.jpg | 2025-06-07 08:08 | 89K | |
![[IMG]](/icons/image2.gif) | Egipska-komnata-tajemnic_strona-www.jpg | 2025-06-08 19:00 | 155K | |
![[IMG]](/icons/image2.gif) | Belka o dofinansowaniu Samorządu Województwa Wielkopolskiego.jpg | 2025-06-08 19:13 | 422K | |
![[IMG]](/icons/image2.gif) | Egipska Komnata Tajemnic Plakat.jpg | 2025-06-08 19:47 | 103K | |
![[IMG]](/icons/image2.gif) | EDA 202 MAP Ikona Wpisu.jpg | 2025-06-08 20:48 | 101K | |
![[IMG]](/icons/image2.gif) | EDA_plakat_GL.png | 2025-06-09 09:02 | 3.4M | |
![[IMG]](/icons/image2.gif) | EDA_plakat_MAP.png | 2025-06-09 09:02 | 2.1M | |
![[IMG]](/icons/image2.gif) | Kolory_strona-www.jpg | 2025-06-09 11:13 | 51K | |
![[IMG]](/icons/image2.gif) | LOgo Muzeum Zmysłów.jpg | 2025-06-12 14:44 | 245K | |
![[IMG]](/icons/image2.gif) | IMG_7995 (1).jpg | 2025-06-16 11:49 | 238K | |
![[IMG]](/icons/image2.gif) | IMG_7995 (1)(1).jpg | 2025-06-16 11:50 | 238K | |
![[IMG]](/icons/image2.gif) | LAM25.jpg | 2025-06-16 11:51 | 238K | |
![[IMG]](/icons/image2.gif) | 6.JPG | 2025-06-16 13:36 | 6.8M | |
![[IMG]](/icons/image2.gif) | 3.JPG | 2025-06-16 13:36 | 8.8M | |
![[IMG]](/icons/image2.gif) | 2.JPG | 2025-06-16 13:36 | 9.8M | |
![[IMG]](/icons/image2.gif) | 4(1).jpg | 2025-06-16 13:36 | 3.1M | |
![[IMG]](/icons/image2.gif) | 5(1).jpg | 2025-06-16 13:36 | 2.2M | |
![[IMG]](/icons/image2.gif) | 1.JPG | 2025-06-16 13:36 | 11M | |
![[IMG]](/icons/image2.gif) | 7(1).jpg | 2025-06-16 13:44 | 265K | |
![[IMG]](/icons/image2.gif) | 8(1).jpg | 2025-06-16 13:44 | 104K | |
![[IMG]](/icons/image2.gif) | 9.jpg | 2025-06-16 13:44 | 556K | |
![[IMG]](/icons/image2.gif) | 10.jpg | 2025-06-16 13:44 | 691K | |
![[IMG]](/icons/image2.gif) | 11.jpg | 2025-06-16 13:44 | 140K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy-o...uzbrojeniu_do-druku_strona-www.jpg | 2025-06-18 09:12 | 73K | |
![[IMG]](/icons/image2.gif) | 23 czerwca Fb.png | 2025-06-18 15:25 | 1.8M | |
![[IMG]](/icons/image2.gif) | Kolory_strona-www(1).jpg | 2025-06-25 12:26 | 50K | |
![[IMG]](/icons/image2.gif) | 20250624_121456.jpg | 2025-06-25 15:22 | 2.3M | |
![[IMG]](/icons/image2.gif) | 20250624_121456(1).jpg | 2025-06-25 15:22 | 2.3M | |
![[IMG]](/icons/image2.gif) | 20250624_121454.jpg | 2025-06-25 15:23 | 2.3M | |
![[IMG]](/icons/image2.gif) | 20250624_121445.jpg | 2025-06-25 15:23 | 2.4M | |
![[IMG]](/icons/image2.gif) | 20250624_121454(1).jpg | 2025-06-25 15:23 | 2.3M | |
![[IMG]](/icons/image2.gif) | 20250624_121454(2).jpg | 2025-06-25 15:24 | 1.5M | |
![[IMG]](/icons/image2.gif) | Untitled_25062025_105111.jpg | 2025-06-25 15:33 | 880K | |
![[IMG]](/icons/image2.gif) | CCI_000001 (1).jpg | 2025-06-25 15:34 | 809K | |
![[IMG]](/icons/image2.gif) | 1328x560.png | 2025-07-10 17:26 | 194K | |
![[IMG]](/icons/image2.gif) | 1328x560(1).png | 2025-07-10 18:17 | 195K | |
![[ ]](/icons/layout.gif) | Unieważnienie zapytania ofertowego projektu aranżacji wystawy - Radość życia w blasku Ra.pdf | 2025-07-11 07:31 | 29K | |
![[IMG]](/icons/image2.gif) | DSC004552.jpg | 2025-08-06 10:52 | 643K | |
![[ ]](/icons/layout.gif) | Unieważnienie zapytania ofertowego projektu aranżacji wystawy - Radość życia w blasku Ra(1).pdf | 2025-08-19 18:35 | 29K | |
![[ ]](/icons/layout.gif) | Informacja_z_otwarcia_ofert(1).pdf | 2025-08-25 18:16 | 534K | |
![[IMG]](/icons/image2.gif) | Ciało-i-znak_strona-www.jpg | 2025-08-29 14:23 | 54K | |
![[IMG]](/icons/image2.gif) | Ciało-i-znak_WEEKEND_strona-www.jpg | 2025-08-29 14:23 | 51K | |
![[IMG]](/icons/image2.gif) | 539263873_1387261786338064_2796992625844595982_n.jpg | 2025-08-29 14:51 | 79K | |
![[ ]](/icons/layout.gif) | 2025_09_05_12_58_26.pdf | 2025-09-05 16:55 | 75K | |
![[IMG]](/icons/image2.gif) | Screenshot_4.jpg | 2025-09-10 12:51 | 43K | |
![[IMG]](/icons/image2.gif) | Prezentacja bez tytułu.jpg | 2025-09-10 12:55 | 28K | |
![[IMG]](/icons/image2.gif) | Screenshot_5.jpg | 2025-09-11 15:16 | 191K | |
![[IMG]](/icons/image2.gif) | Papilon Logo.jpg | 2025-09-14 12:09 | 19K | |
![[IMG]](/icons/image2.gif) | iKONA WPISU bARBARICUM.jpg | 2025-09-14 12:47 | 86K | |
![[IMG]](/icons/image2.gif) | Logotypy na belce Barbaricum.jpg | 2025-09-14 12:51 | 34K | |
![[IMG]](/icons/image2.gif) | 20220725130942_logotypiherbmarszalkawojewodztwawielkopolskiego.jpg | 2025-09-14 12:56 | 81K | |
![[IMG]](/icons/image2.gif) | Ikona wpisu Barbaricum 2.png | 2025-09-14 12:59 | 2.7M | |
![[ ]](/icons/layout.gif) | AB 2025 Program.pdf | 2025-09-14 13:00 | 1.7M | |
![[ ]](/icons/layout.gif) | wynik postepowania map (edit).pdf | 2025-09-14 18:44 | 37K | |
![[IMG]](/icons/image2.gif) | weekend seniora HD_1920x1080.jpg | 2025-09-15 09:32 | 616K | |
![[IMG]](/icons/image2.gif) | Ikona wpisu Barbaricum 22.jpg | 2025-09-15 13:42 | 396K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy-o_oprawa-książek_strona-www.jpg | 2025-09-16 14:37 | 53K | |
![[IMG]](/icons/image2.gif) | ikona wp[isu barbari.jpg | 2025-09-17 11:45 | 163K | |
![[IMG]](/icons/image2.gif) | Logo dla Łukasza.jpg | 2025-09-17 12:12 | 2.9M | |
![[IMG]](/icons/image2.gif) | c5c48028-3814-4c05-a380-be942c5166d9.png | 2025-09-17 14:17 | 2.4M | |
![[IMG]](/icons/image2.gif) | senioralni_poznan.jpg | 2025-09-17 14:18 | 457K | |
![[IMG]](/icons/image2.gif) | Ikona wpisu LPNEA.jpg | 2025-09-23 11:12 | 159K | |
![[IMG]](/icons/image2.gif) | Screenshot_1(2).jpg | 2025-09-23 11:14 | 132K | |
![[IMG]](/icons/image2.gif) | Screenshot_2.jpg | 2025-09-23 11:14 | 153K | |
![[IMG]](/icons/image2.gif) | Screenshot_3.jpg | 2025-09-23 11:14 | 198K | |
![[IMG]](/icons/image2.gif) | Screenshot_4(1).jpg | 2025-09-23 11:14 | 186K | |
![[IMG]](/icons/image2.gif) | 20220725105643_logotypiherbmarszakawojewdztwawielkopolskiego.jpg | 2025-09-24 13:19 | 50K | |
![[IMG]](/icons/image2.gif) | Ikona wpisu konferencja.jpg | 2025-09-24 14:12 | 178K | |
![[ ]](/icons/layout.gif) | ZAPROSZENIE i PROGRAM III Seminarium SM RP EDUKACJA HISTORYCZNA 26 27 09 2025.pdf | 2025-09-24 14:14 | 784K | |
![[IMG]](/icons/image2.gif) | 552462393_1413696207027955_7024898136149639112_n.jpg | 2025-09-24 15:05 | 35K | |
![[IMG]](/icons/image2.gif) | Prezentacja2.jpg | 2025-09-30 09:43 | 84K | |
![[IMG]](/icons/image2.gif) | tablica infrastruktura.jpg | 2025-10-07 23:17 | 69K | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy-o_papugach_str-www.jpg | 2025-10-13 11:31 | 110K | |
![[IMG]](/icons/image2.gif) | halloween_strona-www.jpg | 2025-10-16 09:39 | 164K | |
![[IMG]](/icons/image2.gif) | d5cfcbaa-42dd-410b-ba29-85c807219e73 (2).jpg | 2025-10-20 12:55 | 1.5M | |
![[IMG]](/icons/image2.gif) | Porozmawiajmy-o_dokumentacja_www.jpg | 2025-10-29 10:10 | 79K | |
![[IMG]](/icons/image2.gif) | logo_herb_poziom_iksww_kolor.jpg | 2025-10-29 11:48 | 100K | |
![[IMG]](/icons/image2.gif) | logo MWZ_black_poziom.jpg | 2025-10-29 14:35 | 308K | |
![[IMG]](/icons/image2.gif) | Prezentacja bez tytułu (3).jpg | 2025-11-03 09:29 | 49K | |
![[IMG]](/icons/image2.gif) | kreacje władzy.jpg | 2025-11-03 09:30 | 4.4M | |
![[IMG]](/icons/image2.gif) | poziomy-okładek (1).jpg | 2025-11-06 12:18 | 172K | |
![[IMG]](/icons/image2.gif) | wykadrowany_1920x1080.jpg | 2025-11-12 09:18 | 850K | |
![[IMG]](/icons/image2.gif) | mikołajki_strona-www.jpg | 2025-11-19 11:09 | 108K | |
![[IMG]](/icons/image2.gif) | znaki_strona_www (1).png | 2025-11-25 12:17 | 167K | |
![[IMG]](/icons/image2.gif) | Płyta koncert Polfonia.jpg | 2025-11-28 13:18 | 345K | |
![[IMG]](/icons/image2.gif) | Tło - Ślady, których nie widać.png | 2025-12-04 01:32 | 3.0M | |
![[IMG]](/icons/image2.gif) | organizatorzy.jpg | 2025-12-04 01:34 | 24K | |
![[IMG]](/icons/image2.gif) | Patroni.jpg | 2025-12-04 01:36 | 14K | |
![[IMG]](/icons/image2.gif) | logo marsz.jpg | 2025-12-04 01:42 | 3.6K | |
![[IMG]](/icons/image2.gif) | herb marsz.jpg | 2025-12-04 01:43 | 5.3K | |
![[IMG]](/icons/image2.gif) | logo.jpg | 2025-12-04 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | B1-707x1000mm2 - Wystawa plakat.jpg | 2025-12-04 09:49 | 13M | |
![[IMG]](/icons/image2.gif) | logo(1).jpg | 2025-12-04 09:51 | 13K | |
![[IMG]](/icons/image2.gif) | medal_1920x1080.jpg | 2025-12-05 14:20 | 153K | |
![[IMG]](/icons/image2.gif) | Screenshot_1.png | 2025-12-08 11:23 | 138K | |
![[IMG]](/icons/image2.gif) | wykład 10 grudnia.jpg | 2025-12-08 11:25 | 4.3M | |
![[IMG]](/icons/image2.gif) | wykład 10 grudnia(1).jpg | 2025-12-08 11:27 | 4.3M | |
![[IMG]](/icons/image2.gif) | porozmawiajmy-o_Peru_str-www.jpg | 2025-12-08 14:03 | 86K | |
![[IMG]](/icons/image2.gif) | Zrzut ekranu 2025-12-08 211841.jpg | 2025-12-08 21:19 | 170K | |
![[IMG]](/icons/image2.gif) | Wielkopolska-z-klasą_strona-www.jpg | 2025-12-12 21:21 | 76K | |
![[IMG]](/icons/image2.gif) | Screenshot_2(1).jpg | 2025-12-16 12:57 | 235K | |
![[IMG]](/icons/image2.gif) | Screenshot_2(2).jpg | 2025-12-16 22:25 | 235K | |
![[IMG]](/icons/image2.gif) | Tło godziny Święta.png | 2025-12-17 01:20 | 2.4M | |
![[IMG]](/icons/image2.gif) | Grafika na stronę.png | 2025-12-22 11:11 | 5.3M | |
![[IMG]](/icons/image2.gif) | Prezentacja1(10).jpg | 2025-12-22 11:15 | 161K | |
![[IMG]](/icons/image2.gif) | Obraz1(21).jpg | 2025-12-22 11:17 | 8.6K | |
![[IMG]](/icons/image2.gif) | ikona wpisu www.jpg | 2025-12-24 12:22 | 155K | |
![[IMG]](/icons/image2.gif) | plakat_Klejnoty ekran_pion.jpg | 2025-12-24 12:24 | 952K | |
![[IMG]](/icons/image2.gif) | okładka_projekt ikona wpsu.jpg | 2026-01-07 10:01 | 312K | |
![[IMG]](/icons/image2.gif) | okładka_projekt.jpg | 2026-01-07 10:05 | 4.0M | |
![[IMG]](/icons/image2.gif) | Fot.1 - Tabliczka z tekstem szkolnym - Archiwum Zdjęć MAP.jpg | 2026-01-07 12:59 | 78K | |
![[IMG]](/icons/image2.gif) | TABLICA_fundusz.jpg | 2026-01-08 10:29 | 178K | |
![[IMG]](/icons/image2.gif) | Słoń Trąbibom_i_Trabibombi Elephant.jpg | 2026-01-08 11:48 | 4.0M | |
![[IMG]](/icons/image2.gif) | Kroniki-Archeo_www.jpg | 2026-01-15 23:25 | 161K | |
![[IMG]](/icons/image2.gif) | f523b222-bf14-452a-9430-c8b4da5d1cc5-md.jpeg | 2026-01-19 18:22 | 75K | |
![[IMG]](/icons/image2.gif) | promo-książki-Machajewskiego_www.jpg | 2026-01-20 11:31 | 87K | |
![[IMG]](/icons/image2.gif) | matma-w-mezopotamii_www.jpg | 2026-01-20 13:14 | 77K | |
![[ ]](/icons/unknown.gif) | Śmigacze plażowe (1).sb3 | 2026-01-26 18:07 | 304K | |
![[IMG]](/icons/image2.gif) | Bez-nazwy-2.jpg | 2026-01-28 09:58 | 25K | |
![[IMG]](/icons/image2.gif) | plakat m w z.jpg | 2026-01-29 06:48 | 167K | |
![[IMG]](/icons/image2.gif) | wykład-LMH_www.jpg | 2026-01-29 10:01 | 144K | |
![[IMG]](/icons/image2.gif) | wykład-LMH_wydarzenie-FB.jpg | 2026-01-29 10:03 | 160K | |
![[IMG]](/icons/image2.gif) | ferie_www(1).jpg | 2026-01-29 14:07 | 159K | |
![[IMG]](/icons/image2.gif) | cb6edcf1-a27b-4d60-b609-03bb604baabc.png | 2026-01-30 12:13 | 571K | |
![[IMG]](/icons/image2.gif) | Zrzut ekranu 2026-01-30 121902.png | 2026-01-30 12:19 | 82K | |
![[IMG]](/icons/image2.gif) | Zrzut ekranu 2026-01-30 121920.png | 2026-01-30 12:19 | 53K | |
![[IMG]](/icons/image2.gif) | Zrzut ekranu 2026-01-30 121920(1).png | 2026-01-30 12:20 | 53K | |
![[IMG]](/icons/image2.gif) | Ikona wpisu.jpg | 2026-01-30 12:40 | 175K | |
![[IMG]](/icons/image2.gif) | Kresy Eyropy Ikona Wpisu.png | 2026-02-01 21:09 | 2.6M | |
![[IMG]](/icons/image2.gif) | wykład_11.02._www.jpg | 2026-02-02 14:45 | 83K | |
![[IMG]](/icons/image2.gif) | DORA WALENTYNKI STRONA.jpg | 2026-02-06 15:25 | 493K | |
![[ ]](/icons/unknown.gif) | labirynt z ruchomymi przeszkodami .sb3 | 2026-02-09 16:52 | 233K | |
![[IMG]](/icons/image2.gif) | Plakat.jpg | 2026-02-11 15:02 | 657K | |
![[ ]](/icons/layout.gif) | ogloszenie_aranzacja_2025.pdf | 2026-02-12 16:07 | 95K | |
![[IMG]](/icons/image2.gif) | Projekt plakatu- Format A3 Pati.jpg | 2026-02-20 14:14 | 3.4M | |
![[IMG]](/icons/image2.gif) | Dzień-kobiet_www.jpg | 2026-02-28 08:38 | 81K | |
![[IMG]](/icons/image2.gif) | Patryk_www.jpg | 2026-03-06 09:09 | 76K | |
![[IMG]](/icons/image2.gif) | Kresy-Europy_www.jpg | 2026-03-09 11:08 | 109K | |
![[IMG]](/icons/image2.gif) | Gambit-królowej_www.jpg | 2026-03-12 08:54 | 51K | |
![[ ]](/icons/layout.gif) | program_SZTUKA_W_WIELKOPOLSCE.pdf | 2026-03-12 11:14 | 1.3M | |
![[IMG]](/icons/image2.gif) | SHS Konferencja.jpg | 2026-03-12 11:21 | 106K | |
![[IMG]](/icons/image2.gif) | Screenshot_2(2)(1).jpg | 2026-03-12 12:20 | 98K | |
![[IMG]](/icons/image2.gif) | WIELKI POST strona.jpg | 2026-03-16 15:41 | 270K | |
![[IMG]](/icons/image2.gif) | lodz z ladu.png | 2026-03-16 16:07 | 1.7M | |
![[IMG]](/icons/image2.gif) | XXV Konferencja sprawozdawcza - Program.jpg | 2026-03-25 08:40 | 1.9M | |
![[IMG]](/icons/image2.gif) | XXV Konferencja sprawozdawcza.jpg | 2026-03-25 08:47 | 1.3M | |
![[IMG]](/icons/image2.gif) | cropped_1920x1080.png | 2026-04-02 08:19 | 1.3M | |
![[IMG]](/icons/image2.gif) | stronawww.jpg | 2026-04-02 14:09 | 108K | |
![[ ]](/icons/layout.gif) | Załącznik nr 1 - oświadczenie.pdf | 2026-04-02 14:10 | 40K | |
![[ ]](/icons/layout.gif) | Załącznik nr 2 - klauzula informacyjna.pdf | 2026-04-02 14:10 | 56K | |
![[ ]](/icons/layout.gif) | Regulamin naboru prac artystycznych - Śmieciologia.MAP.pdf | 2026-04-03 14:20 | 143K | |
![[IMG]](/icons/image2.gif) | jaskinie_www.jpg | 2026-04-08 09:34 | 80K | |
![[IMG]](/icons/image2.gif) | XXV-Konferencja-sprawozdawcza_www.jpg | 2026-04-08 12:29 | 73K | |
![[IMG]](/icons/image2.gif) | zaproszenie_www.jpg | 2026-04-10 09:24 | 87K | |
![[IMG]](/icons/image2.gif) | zaproszenie-01.jpg | 2026-04-10 09:30 | 176K | |
![[IMG]](/icons/image2.gif) | zaproszenie-02.jpg | 2026-04-10 09:30 | 278K | |
![[IMG]](/icons/image2.gif) | Screenshot_2(3).jpg | 2026-04-10 15:55 | 90K | |
![[IMG]](/icons/image2.gif) | miniaturki_kadr.jpeg | 2026-04-13 12:19 | 7.3K | |
![[SND]](/icons/sound2.gif) | 001.wprowadzenie do wystawy.mp3 | 2026-04-13 12:23 | 3.8M | |
![[SND]](/icons/sound2.gif) | 021.mp3 | 2026-04-14 09:23 | 379K | |
![[IMG]](/icons/image2.gif) | 021.jpg | 2026-04-14 09:23 | 2.8M | |
![[IMG]](/icons/image2.gif) | 022.jpeg | 2026-04-14 09:42 | 11K | |
![[SND]](/icons/sound2.gif) | 022.mp3 | 2026-04-14 09:42 | 1.1M | |
![[IMG]](/icons/image2.gif) | Skarby-z-wody_www.jpg | 2026-04-15 09:10 | 87K | |
![[IMG]](/icons/image2.gif) | konfa_www.jpg | 2026-04-16 08:53 | 153K | |
![[IMG]](/icons/image2.gif) | FB_IMG_1775905953893.jpg | 2026-04-16 08:54 | 253K | |
![[IMG]](/icons/image2.gif) | FB_IMG_1775905958132.jpg | 2026-04-16 08:54 | 249K | |
![[IMG]](/icons/image2.gif) | ArcheologiaHumoru-FB-prelekcja5.jpg | 2026-04-20 09:36 | 343K | |
![[IMG]](/icons/image2.gif) | Frąckowiak_www2.jpg | 2026-04-20 14:47 | 82K | |
![[IMG]](/icons/image2.gif) | ArcheologiaHumoru-FB-prelekcja6.jpg | 2026-05-05 08:18 | 290K | |
![[IMG]](/icons/image2.gif) | Płaza_Stempin_www.jpg | 2026-05-05 08:57 | 84K | |
![[IMG]](/icons/image2.gif) | łodzie_www.jpg | 2026-05-05 10:53 | 90K | |
![[IMG]](/icons/image2.gif) | EGIPT Head.jpg | 2026-05-07 09:21 | 7.2M | |
![[IMG]](/icons/image2.gif) | ArcheologiaHumoru-FB-prelekcja7.jpg | 2026-05-11 12:17 | 291K | |
![[IMG]](/icons/image2.gif) | 4a0f03e3-b4ea-448f-a2f7-31319824905b.png | 2026-05-11 12:23 | 2.1M | |
![[IMG]](/icons/image2.gif) | 88820103-67c8-438a-a50b-2c999de7a075.png | 2026-05-11 12:26 | 2.2M | |
![[IMG]](/icons/image2.gif) | IMG_0686.JPG.jpg | 2026-05-19 10:23 | 4.2M | |
![[IMG]](/icons/image2.gif) | IMG_0677.JPG.jpg | 2026-05-19 10:26 | 3.6M | |
![[IMG]](/icons/image2.gif) | IMG_0680.JPG.jpg | 2026-05-19 10:28 | 3.6M | |
![[IMG]](/icons/image2.gif) | IMG_0685.JPG.jpg | 2026-05-19 10:28 | 4.6M | |
![[IMG]](/icons/image2.gif) | IMG_0719.JPG.jpg | 2026-05-19 10:29 | 3.6M | |
![[IMG]](/icons/image2.gif) | IMG_0745.JPG.jpg | 2026-05-19 10:31 | 3.9M | |
![[ ]](/icons/layout.gif) | List Otwarty-160526.pdf | 2026-05-20 11:24 | 540K | |
![[IMG]](/icons/image2.gif) | list-1.jpg | 2026-05-20 12:20 | 95K | |
![[IMG]](/icons/image2.gif) | list-2.jpg | 2026-05-20 12:20 | 105K | |
![[IMG]](/icons/image2.gif) | list-3.jpg | 2026-05-20 12:20 | 108K | |
![[IMG]](/icons/image2.gif) | list-4.jpg | 2026-05-20 12:20 | 99K | |
![[IMG]](/icons/image2.gif) | Set-of-Four-Warning-Signs.jpg | 2026-05-20 12:24 | 62K | |
![[IMG]](/icons/image2.gif) | Śmieciologia_www.jpg | 2026-05-20 14:53 | 161K | |
![[IMG]](/icons/image2.gif) | EDA_promo-ksiązki_strona-www.jpg | 2026-06-08 10:23 | 79K | |
![[IMG]](/icons/image2.gif) | EDA-2026_MAP_strona-www.jpg | 2026-06-08 10:35 | 100K | |
![[IMG]](/icons/image2.gif) | logotypy.jpg | 2026-06-08 10:39 | 36K | |
![[IMG]](/icons/image2.gif) | krucjata_www.jpg | 2026-06-08 11:17 | 121K | |
![[IMG]](/icons/image2.gif) | Góra-Z_www.jpg | 2026-06-09 09:17 | 129K | |
![[IMG]](/icons/image2.gif) | kości-królewskie_www.jpg | 2026-06-11 09:47 | 161K | |
![[IMG]](/icons/image2.gif) | afisz B1.jpg | 2026-06-11 09:47 | 3.8M | |
![[IMG]](/icons/image2.gif) | plakat B1.jpg | 2026-06-11 09:47 | 3.9M | |
![[IMG]](/icons/image2.gif) | LAM_strona-www.jpg | 2026-06-14 17:31 | 226K | |
![[IMG]](/icons/image2.gif) | LAM2_strona-www.jpg | 2026-06-14 17:48 | 228K | |
![[IMG]](/icons/image2.gif) | Artysci_www.jpg | 2026-06-18 15:01 | 74K | |
![[IMG]](/icons/image2.gif) | Prezentacja1(11).jpg | 2026-06-19 08:42 | 140K | |
![[IMG]](/icons/image2.gif) | IMG_0989.jpg | 2026-06-30 09:43 | 7.8M | |
![[IMG]](/icons/image2.gif) | winda-nieczynna_www.jpg | 2026-07-02 11:57 | 26K | |
![[IMG]](/icons/image2.gif) | G.-Zyndrama_www.jpg | 2026-07-24 10:22 | 118K | |
![[IMG]](/icons/image2.gif) | Svitlana Ivanova.jpg | 2026-08-03 11:58 | 127K | |
![[IMG]](/icons/image2.gif) | IMG_0559.jpeg | 2026-08-03 13:12 | 1.3M | |
![[IMG]](/icons/image2.gif) | dofinansowanie.png | 2026-08-03 13:15 | 93K | |
![[IMG]](/icons/image2.gif) | dofinansowanie_IKSWW.jpg | 2026-08-04 10:50 | 8.8K | |
![[IMG]](/icons/image2.gif) | dofinansowanie_stopka_1.jpg | 2026-08-04 11:11 | 140K | |
![[IMG]](/icons/image2.gif) | dofinansowanie_stopka_2.jpg | 2026-08-04 12:39 | 98K | |
![[IMG]](/icons/image2.gif) | 1b1d7d14-6e83-4ab6-8c3a-c36031375944.png | 2026-08-05 10:58 | 1.5M | |
![[IMG]](/icons/image2.gif) | xznaki_strona_www-1536x511.png.pagespeed.ic.WOTxDP8JGx.webp | 2026-08-05 10:58 | 38K | |
![[IMG]](/icons/image2.gif) | Screenshot_1(3).jpg | 2026-08-05 11:01 | 39K | |
![[IMG]](/icons/image2.gif) | 634967531_1549557097176611_3297426037079560400_n.jpg | 2026-08-06 19:21 | 106K | |
![[IMG]](/icons/image2.gif) | eed8f535-d4e4-4e9a-a973-45344f90e297.png | 2026-08-16 20:06 | 2.6M | |
![[IMG]](/icons/image2.gif) | dofinansowanie_SWW.jpg | 2026-08-19 12:24 | 8.0M | |
![[IMG]](/icons/image2.gif) | Drogi_strona-www2.jpg | 2026-08-19 12:28 | 175K | |
![[IMG]](/icons/image2.gif) | UISPP_biale_JPG.jpg | 2026-08-20 09:25 | 111K | |
![[IMG]](/icons/image2.gif) | UISPP.jpg | 2026-08-20 09:29 | 102K | |
![[IMG]](/icons/image2.gif) | 792915437_1717978096599763_1708538174679055785_n.jpg | 2026-09-07 13:45 | 135K | |
![[IMG]](/icons/image2.gif) | Archeologia dźwięku kompas kafel i iks.jpg | 2026-09-11 09:56 | 158K | |
![[IMG]](/icons/image2.gif) | 01_znak_siatka_podstawowy_kolor_biale_tlo (2).png | 2026-09-11 09:57 | 59K | |
![[IMG]](/icons/image2.gif) | dofinansowanie_stopka_2 (2).jpg | 2026-09-11 09:57 | 60K | |
![[DIR]](/icons/folder.gif) | 00001 Wystawy Stałe/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | 00002 Śmierć i Życie w starożytnym Egipcie/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | 01 Wszystkie działania/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | 50 lat/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | AKademia Malucha/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | ARche, archeo, archeologia/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Agata/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Akademia Genius Loci/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Archeo gry/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Archeologia Sudanu/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Archeologia i sztuka/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Archeologia wielkopolska w odrodzonej Rzeczpospolitej – konserwacja kolekcji szklanych negatywów fotograficznych/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Archeorama/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Archiwalia na nowo ujawnione/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Archiwum COvid/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Atofri/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Audioprzewodnik QR/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Awar/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Badania Rynku/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Barbarzyńskie Tsunami Wystawa/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Białoruś/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Blask CHristianitatis/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Chrobry/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Co 600/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Dawni Dyrektorzy/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Dobrzyca/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Dobrzyca 2017/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Dotacje/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Drogi do przeszłości_eng/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Duda w Rezerwie/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Dział Archeologii Historycznej/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Dział Archeologii Pozaeuropejskiej/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Dział DOkumentacji i Informacji Naukowej/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Dzieł Archeologii Pradziejowej/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | EDA/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Edukacja/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Edukacyjny zakątek/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Edukujmy się/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Egipt Zamknięcie/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Egyptian Gallery/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Elementy Śmierć i życie w starożytnym Egipcie/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Farcha/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Fontes/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Gabloty dla Mateusza Sikory/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Galeria Pokoje Gościnne/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Góra Zyndrama/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Geniusz Europy/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Gniezno/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Historia zapisana w ziemi Badania archeologiczne na Starym Rynku w Poznaniu/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Ikony Wpisu/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Introligacja/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Izabella/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Izabella 2024/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Izabella Kostrzewski/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | JP II Konferencja/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Jaćwingowie/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Jest impreza/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Kafle z badań w Pałacu Górków/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Karty zniżkowe/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Katalog Genius Loci/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | KOnkurs publikacji PTPN/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Kirgistan/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Konferencja SPrawozdawcza/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Konkurs/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Kotlo/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Kto był królem/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Ląd/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | LPNEA/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Letnia Akademia Malucha/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Logotyp Marszałek/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Logotypy/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Ląd 2018/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Ląd 2025 galeria/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Ląd elementy/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Mój starożytny Egipt Prace/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Muzeum Pod Wirtualną Lupą/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | NCN Nagroda/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Nagrody/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | nagroda Rady Miasta/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | NOC/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Newslettery/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Nieopowiedziane historie lalek/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Nieznane zabytki okresu Awarskiego/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Niezwykłe Dzieje Pałacu Górków - wystawa/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Noc Muzeów Online/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Novae/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Nowa wystawa egipska/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | OLIOC/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Obelisk/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Obserwacja Pracy Berlin Turnus I/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Patryk/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Perełki/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Perełki z Magazynów MAP/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Podwieczorki z Egiptem/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | news/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Pokoje Gościnne/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/back.gif) | Porozmawiajmy o.../ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Powstanie Wielkopolskie/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Poznańskie Dni Rodziny/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Prace wykopaliskowe w miejscu powstania Rezerwatu Archeologicznego/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Pradzieje/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Projekty/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Przetarg samochód/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Przyciski Wystaw PRZED i PO/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Publikacje/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Publikacje ikony wpisu/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Python/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Q24/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | QR kody/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Qr Kody Archeologia Sudanu/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | RTI/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Radość życia w blasku Ra/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Razem przez Wieki/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Regulamin Covid Lekcje 10.05/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Regulamin Cowid Angielski/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Regulamin Zwiedzania/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | SAA/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Senioralni/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Siła w nas/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | SNAP/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Skały w ruchu/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Skarbnica tekstów MAP/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Sobota wykopaliska koło Rokietnicy/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Spacer/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Srem projekt/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Standardy ochrony małoletnich/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Statut MAP 2023/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Sziedziba Muzeum/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | T. Jakimowicz Wyjątki/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Teleport do przeszłości/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Trzy Filary Uniwersytetu - Kolegium Jezuickie i Uniwersytet/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | tab/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Tłusty czwartek/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Tu Powstała Polska/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Turniej gier/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Tu się wszystko zacżęlo/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Uczta na progu wieczności/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Ukraina przed/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Walentynki/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Weekend egipski/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Weekend w renesansowym poznaniu/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Wielkanoc/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Wirtualne Drzwi Otwarte/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Wykłady/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Wynajem Sal/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Wystawy Stałe prezentacje/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Wystawy dawne/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Wystawy dawne na www/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | XLS Sklepik/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Łazarski od spodu/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Ścieżka/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Ścieżka pliki/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Święto muzelanika/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | śmierć i życie w starożytnym egipcie/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Żywot długi, pracowity i spełniony Profesor Józef Kostrzewski (1885-1969) – prehistoryk, patriota, Europejczyk - Jarmila Elżbieta Kaczmarek, Andrzej Prinke/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | XX-PROTOBARB/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Zakamarki/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Zap of remont kanal/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Zapytania podprogowe/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Zapytanie kotłownia/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Zdroowie i Higiena Wystawa/ | 2026-09-11 09:59 | - | |
![[DIR]](/icons/folder.gif) | Z wędką po wiedzę/ | 2026-09-11 09:59 | - | |
|